the whole shebang

vendor/monolog/monolog/CHANGELOG.mdown

@@ -0,0 +1,110 @@
+### 1.6.0 (2013-07-29)
+
+  * Added HipChatHandler to send logs to a HipChat chat room
+  * Added ErrorLogHandler to send logs to PHP's error_log function
+  * Added NewRelicHandler to send logs to NewRelic's service
+  * Added Monolog\ErrorHandler helper class to register a Logger as exception/error/fatal handler
+  * Added ChannelLevelActivationStrategy for the FingersCrossedHandler to customize levels by channel
+  * Added stack traces output when normalizing exceptions (json output & co)
+  * Added Monolog\Logger::API constant (currently 1)
+  * Added support for ChromePHP's v4.0 extension
+  * Added support for message priorities in PushoverHandler, see $highPriorityLevel and $emergencyLevel
+  * Added support for sending messages to multiple users at once with the PushoverHandler
+  * Fixed RavenHandler's support for batch sending of messages (when behind a Buffer or FingersCrossedHandler)
+  * Fixed normalization of Traversables with very large data sets, only the first 1000 items are shown now
+  * Fixed issue in RotatingFileHandler when an open_basedir restriction is active
+  * Fixed minor issues in RavenHandler and bumped the API to Raven 0.5.0
+  * Fixed SyslogHandler issue when many were used concurrently with different facilities
+
+### 1.5.0 (2013-04-23)
+
+  * Added ProcessIdProcessor to inject the PID in log records
+  * Added UidProcessor to inject a unique identifier to all log records of one request/run
+  * Added support for previous exceptions in the LineFormatter exception serialization
+  * Added Monolog\Logger::getLevels() to get all available levels
+  * Fixed ChromePHPHandler so it avoids sending headers larger than Chrome can handle
+
+### 1.4.1 (2013-04-01)
+
+  * Fixed exception formatting in the LineFormatter to be more minimalistic
+  * Fixed RavenHandler's handling of context/extra data, requires Raven client >0.1.0
+  * Fixed log rotation in RotatingFileHandler to work with long running scripts spanning multiple days
+  * Fixed WebProcessor array access so it checks for data presence
+  * Fixed Buffer, Group and FingersCrossed handlers to make use of their processors
+
+### 1.4.0 (2013-02-13)
+
+  * Added RedisHandler to log to Redis via the Predis library or the phpredis extension
+  * Added ZendMonitorHandler to log to the Zend Server monitor
+  * Added the possibility to pass arrays of handlers and processors directly in the Logger constructor
+  * Added `$useSSL` option to the PushoverHandler which is enabled by default
+  * Fixed ChromePHPHandler and FirePHPHandler issue when multiple instances are used simultaneously
+  * Fixed header injection capability in the NativeMailHandler
+
+### 1.3.1 (2013-01-11)
+
+  * Fixed LogstashFormatter to be usable with stream handlers
+  * Fixed GelfMessageFormatter levels on Windows
+
+### 1.3.0 (2013-01-08)
+
+  * Added PSR-3 compliance, the `Monolog\Logger` class is now an instance of `Psr\Log\LoggerInterface`
+  * Added PsrLogMessageProcessor that you can selectively enable for full PSR-3 compliance
+  * Added LogstashFormatter (combine with SocketHandler or StreamHandler to send logs to Logstash)
+  * Added PushoverHandler to send mobile notifications
+  * Added CouchDBHandler and DoctrineCouchDBHandler
+  * Added RavenHandler to send data to Sentry servers
+  * Added support for the new MongoClient class in MongoDBHandler
+  * Added microsecond precision to log records' timestamps
+  * Added `$flushOnOverflow` param to BufferHandler to flush by batches instead of losing
+    the oldest entries
+  * Fixed normalization of objects with cyclic references
+
+### 1.2.1 (2012-08-29)
+
+  * Added new $logopts arg to SyslogHandler to provide custom openlog options
+  * Fixed fatal error in SyslogHandler
+
+### 1.2.0 (2012-08-18)
+
+  * Added AmqpHandler (for use with AMQP servers)
+  * Added CubeHandler
+  * Added NativeMailerHandler::addHeader() to send custom headers in mails
+  * Added the possibility to specify more than one recipient in NativeMailerHandler
+  * Added the possibility to specify float timeouts in SocketHandler
+  * Added NOTICE and EMERGENCY levels to conform with RFC 5424
+  * Fixed the log records to use the php default timezone instead of UTC
+  * Fixed BufferHandler not being flushed properly on PHP fatal errors
+  * Fixed normalization of exotic resource types
+  * Fixed the default format of the SyslogHandler to avoid duplicating datetimes in syslog
+
+### 1.1.0 (2012-04-23)
+
+  * Added Monolog\Logger::isHandling() to check if a handler will
+    handle the given log level
+  * Added ChromePHPHandler
+  * Added MongoDBHandler
+  * Added GelfHandler (for use with Graylog2 servers)
+  * Added SocketHandler (for use with syslog-ng for example)
+  * Added NormalizerFormatter
+  * Added the possibility to change the activation strategy of the FingersCrossedHandler
+  * Added possibility to show microseconds in logs
+  * Added `server` and `referer` to WebProcessor output
+
+### 1.0.2 (2011-10-24)
+
+  * Fixed bug in IE with large response headers and FirePHPHandler
+
+### 1.0.1 (2011-08-25)
+
+  * Added MemoryPeakUsageProcessor and MemoryUsageProcessor
+  * Added Monolog\Logger::getName() to get a logger's channel name
+
+### 1.0.0 (2011-07-06)
+
+  * Added IntrospectionProcessor to get info from where the logger was called
+  * Fixed WebProcessor in CLI
+
+### 1.0.0-RC1 (2011-07-01)
+
+  * Initial release

vendor/monolog/monolog/LICENSE

@@ -0,0 +1,19 @@
+Copyright (c) Jordi Boggiano
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is furnished
+to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

vendor/monolog/monolog/README.mdown

@@ -0,0 +1,248 @@
+Monolog - Logging for PHP 5.3+ [![Build Status](https://secure.travis-ci.org/Seldaek/monolog.png)](http://travis-ci.org/Seldaek/monolog)
+==============================
+
+[![Total Downloads](https://poser.pugx.org/monolog/monolog/downloads.png)](https://packagist.org/packages/monolog/monolog)
+[![Latest Stable Version](https://poser.pugx.org/monolog/monolog/v/stable.png)](https://packagist.org/packages/monolog/monolog)
+
+
+Monolog sends your logs to files, sockets, inboxes, databases and various
+web services. See the complete list of handlers below. Special handlers
+allow you to build advanced logging strategies.
+
+This library implements the [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md)
+interface that you can type-hint against in your own libraries to keep
+a maximum of interoperability. You can also use it in your applications to
+make sure you can always use another compatible logger at a later time.
+
+Usage
+-----
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+
+// create a log channel
+$log = new Logger('name');
+$log->pushHandler(new StreamHandler('path/to/your.log', Logger::WARNING));
+
+// add records to the log
+$log->addWarning('Foo');
+$log->addError('Bar');
+```
+
+Core Concepts
+-------------
+
+Every `Logger` instance has a channel (name) and a stack of handlers. Whenever
+you add a record to the logger, it traverses the handler stack. Each handler
+decides whether it handled fully the record, and if so, the propagation of the
+record ends there.
+
+This allows for flexible logging setups, for example having a `StreamHandler` at
+the bottom of the stack that will log anything to disk, and on top of that add
+a `MailHandler` that will send emails only when an error message is logged.
+Handlers also have a `$bubble` property which defines whether they block the
+record or not if they handled it. In this example, setting the `MailHandler`'s
+`$bubble` argument to false means that records handled by the `MailHandler` will
+not propagate to the `StreamHandler` anymore.
+
+You can create many `Logger`s, each defining a channel (e.g.: db, request,
+router, ..) and each of them combining various handlers, which can be shared
+or not. The channel is reflected in the logs and allows you to easily see or
+filter records.
+
+Each Handler also has a Formatter, a default one with settings that make sense
+will be created if you don't set one. The formatters normalize and format
+incoming records so that they can be used by the handlers to output useful
+information.
+
+Custom severity levels are not available. Only the eight
+[RFC 5424](http://tools.ietf.org/html/rfc5424) levels (debug, info, notice,
+warning, error, critical, alert, emergency) are present for basic filtering
+purposes, but for sorting and other use cases that would require
+flexibility, you should add Processors to the Logger that can add extra
+information (tags, user ip, ..) to the records before they are handled.
+
+Log Levels
+----------
+
+Monolog supports all 8 logging levels defined in
+[RFC 5424](http://tools.ietf.org/html/rfc5424), but unless you specifically
+need syslog compatibility, it is advised to only use DEBUG, INFO, WARNING,
+ERROR, CRITICAL, ALERT.
+
+- **DEBUG** (100): Detailed debug information.
+
+- **INFO** (200): Interesting events. Examples: User logs in, SQL logs.
+
+- NOTICE (250): Normal but significant events.
+
+- **WARNING** (300): Exceptional occurrences that are not errors. Examples:
+  Use of deprecated APIs, poor use of an API, undesirable things that are not
+  necessarily wrong.
+
+- **ERROR** (400): Runtime errors that do not require immediate action but
+  should typically be logged and monitored.
+
+- **CRITICAL** (500): Critical conditions. Example: Application component
+  unavailable, unexpected exception.
+
+- **ALERT** (550): Action must be taken immediately. Example: Entire website
+  down, database unavailable, etc. This should trigger the SMS alerts and wake
+  you up.
+
+- EMERGENCY (600): Emergency: system is unusable.
+
+Docs
+====
+
+**See the `doc` directory for more detailed documentation.
+The following is only a list of all parts that come with Monolog.**
+
+Handlers
+--------
+
+### Log to files and syslog
+
+- _StreamHandler_: Logs records into any PHP stream, use this for log files.
+- _RotatingFileHandler_: Logs records to a file and creates one logfile per day.
+  It will also delete files older than `$maxFiles`. You should use
+  [logrotate](http://linuxcommand.org/man_pages/logrotate8.html) for high profile
+  setups though, this is just meant as a quick and dirty solution.
+- _SyslogHandler_: Logs records to the syslog.
+- _ErrorLogHandler_: Logs records to PHP's
+  [`error_log()`](http://docs.php.net/manual/en/function.error-log.php) function.
+
+### Send alerts and emails
+
+- _NativeMailerHandler_: Sends emails using PHP's
+  [`mail()`](http://php.net/manual/en/function.mail.php) function.
+- _SwiftMailerHandler_: Sends emails using a [`Swift_Mailer`](http://swiftmailer.org/) instance.
+- _PushoverHandler_: Sends mobile notifications via the [Pushover](https://www.pushover.net/) API.
+- _HipChatHandler_: Logs records to a [HipChat](http://hipchat.com) chat room using its API.
+
+### Log specific servers and networked logging
+
+- _SocketHandler_: Logs records to [sockets](http://php.net/fsockopen), use this
+  for UNIX and TCP sockets. See an [example](https://github.com/Seldaek/monolog/blob/master/doc/sockets.md).
+- _AmqpHandler_: Logs records to an [amqp](http://www.amqp.org/) compatible
+  server. Requires the [php-amqp](http://pecl.php.net/package/amqp) extension (1.0+).
+- _GelfHandler_: Logs records to a [Graylog2](http://www.graylog2.org) server.
+- _CubeHandler_: Logs records to a [Cube](http://square.github.com/cube/) server.
+- _RavenHandler_: Logs records to a [Sentry](http://getsentry.com/) server using
+  [raven](https://packagist.org/packages/raven/raven).
+- _ZendMonitorHandler_: Logs records to the Zend Monitor present in Zend Server.
+- _NewRelicHandler_: Logs records to a [NewRelic](http://newrelic.com/) application.
+
+### Logging in development
+
+- _FirePHPHandler_: Handler for [FirePHP](http://www.firephp.org/), providing
+  inline `console` messages within [FireBug](http://getfirebug.com/).
+- _ChromePHPHandler_: Handler for [ChromePHP](http://www.chromephp.com/), providing
+  inline `console` messages within Chrome.
+
+### Log to databases
+
+- _RedisHandler_: Logs records to a [redis](http://redis.io) server.
+- _MongoDBHandler_: Handler to write records in MongoDB via a
+  [Mongo](http://pecl.php.net/package/mongo) extension connection.
+- _CouchDBHandler_: Logs records to a CouchDB server.
+- _DoctrineCouchDBHandler_: Logs records to a CouchDB server via the Doctrine CouchDB ODM.
+
+### Wrappers / Special Handlers
+
+- _FingersCrossedHandler_: A very interesting wrapper. It takes a logger as
+  parameter and will accumulate log records of all levels until a record
+  exceeds the defined severity level. At which point it delivers all records,
+  including those of lower severity, to the handler it wraps. This means that
+  until an error actually happens you will not see anything in your logs, but
+  when it happens you will have the full information, including debug and info
+  records. This provides you with all the information you need, but only when
+  you need it.
+- _NullHandler_: Any record it can handle will be thrown away. This can be used
+  to put on top of an existing handler stack to disable it temporarily.
+- _BufferHandler_: This handler will buffer all the log records it receives
+  until `close()` is called at which point it will call `handleBatch()` on the
+  handler it wraps with all the log messages at once. This is very useful to
+  send an email with all records at once for example instead of having one mail
+  for every log record.
+- _GroupHandler_: This handler groups other handlers. Every record received is
+  sent to all the handlers it is configured with.
+- _TestHandler_: Used for testing, it records everything that is sent to it and
+  has accessors to read out the information.
+
+Formatters
+----------
+
+- _LineFormatter_: Formats a log record into a one-line string.
+- _NormalizerFormatter_: Normalizes objects/resources down to strings so a record can easily be serialized/encoded.
+- _JsonFormatter_: Encodes a log record into json.
+- _WildfireFormatter_: Used to format log records into the Wildfire/FirePHP protocol, only useful for the FirePHPHandler.
+- _ChromePHPFormatter_: Used to format log records into the ChromePHP format, only useful for the ChromePHPHandler.
+- _GelfFormatter_: Used to format log records into Gelf message instances, only useful for the GelfHandler.
+- _LogstashFormatter_: Used to format log records into [logstash](http://logstash.net/) event json, useful for any handler listed under inputs [here](http://logstash.net/docs/1.1.5/).
+
+Processors
+----------
+
+- _IntrospectionProcessor_: Adds the line/file/class/method from which the log call originated.
+- _WebProcessor_: Adds the current request URI, request method and client IP to a log record.
+- _MemoryUsageProcessor_: Adds the current memory usage to a log record.
+- _MemoryPeakUsageProcessor_: Adds the peak memory usage to a log record.
+- _ProcessIdProcessor_: Adds the process id to a log record.
+- _UidProcessor_: Adds a unique identifier to a log record.
+
+Utilities
+---------
+
+- _ErrorHandler_: The `Monolog\ErrorHandler` class allows you to easily register
+  a Logger instance as an exception handler, error handler or fatal error handler.
+- _ErrorLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain log
+  level is reached.
+- _ChannelLevelActivationStrategy_: Activates a FingersCrossedHandler when a certain
+  log level is reached, depending on which channel received the log record.
+
+About
+=====
+
+Requirements
+------------
+
+- Any flavor of PHP 5.3 or above should do
+- [optional] PHPUnit 3.5+ to execute the test suite (phpunit --version)
+
+Submitting bugs and feature requests
+------------------------------------
+
+Bugs and feature request are tracked on [GitHub](https://github.com/Seldaek/monolog/issues)
+
+Frameworks Integration
+----------------------
+
+- Frameworks and libraries using [PSR-3](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-3-logger-interface.md)
+  can be used very easily with Monolog since it implements the interface.
+- [Symfony2](http://symfony.com) comes out of the box with Monolog.
+- [Silex](http://silex.sensiolabs.org/) comes out of the box with Monolog.
+- [Laravel4](http://laravel.com/) comes out of the box with Monolog.
+- [PPI](http://www.ppi.io/) comes out of the box with Monolog.
+- [CakePHP](http://cakephp.org/) is usable with Monolog via the [cakephp-monolog](https://github.com/jadb/cakephp-monolog) plugin.
+- [Slim](http://www.slimframework.com/) is usable with Monolog via the [Slim-Monolog](https://github.com/Flynsarmy/Slim-Monolog) log writer.
+
+Author
+------
+
+Jordi Boggiano - <j.boggiano@seld.be> - <http://twitter.com/seldaek><br />
+See also the list of [contributors](https://github.com/Seldaek/monolog/contributors) which participated in this project.
+
+License
+-------
+
+Monolog is licensed under the MIT License - see the `LICENSE` file for details
+
+Acknowledgements
+----------------
+
+This library is heavily inspired by Python's [Logbook](http://packages.python.org/Logbook/)
+library, although most concepts have been adjusted to fit to the PHP world.

vendor/monolog/monolog/composer.json

@@ -0,0 +1,39 @@
+{
+    "name": "monolog/monolog",
+    "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+    "keywords": ["log", "logging", "psr-3"],
+    "homepage": "http://github.com/Seldaek/monolog",
+    "type": "library",
+    "license": "MIT",
+    "authors": [
+        {
+            "name": "Jordi Boggiano",
+            "email": "j.boggiano@seld.be",
+            "homepage": "http://seld.be"
+        }
+    ],
+    "require": {
+        "php": ">=5.3.0",
+        "psr/log": "~1.0"
+    },
+    "require-dev": {
+        "mlehner/gelf-php": "1.0.*",
+        "raven/raven": "0.5.*",
+        "doctrine/couchdb": "dev-master"
+    },
+    "suggest": {
+        "mlehner/gelf-php": "Allow sending log messages to a GrayLog2 server",
+        "raven/raven": "Allow sending log messages to a Sentry server",
+        "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+        "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+        "ext-mongo": "Allow sending log messages to a MongoDB server"
+    },
+    "autoload": {
+        "psr-0": {"Monolog": "src/"}
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "1.6.x-dev"
+        }
+    }
+}

vendor/monolog/monolog/doc/extending.md

@@ -0,0 +1,76 @@
+Extending Monolog
+=================
+
+Monolog is fully extensible, allowing you to adapt your logger to your needs.
+
+Writing your own handler
+------------------------
+
+Monolog provides many built-in handlers. But if the one you need does not
+exist, you can write it and use it in your logger. The only requirement is
+to implement `Monolog\Handler\HandlerInterface`.
+
+Let's write a PDOHandler to log records to a database. We will extend the
+abstract class provided by Monolog to keep things DRY.
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\AbstractProcessingHandler;
+
+class PDOHandler extends AbstractProcessingHandler
+{
+    private $initialized = false;
+    private $pdo;
+    private $statement;
+
+    public function __construct(PDO $pdo, $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->pdo = $pdo;
+        parent::__construct($level, $bubble);
+    }
+
+    protected function write(array $record)
+    {
+        if (!$this->initialized) {
+            $this->initialize();
+        }
+
+        $this->statement->execute(array(
+            'channel' => $record['channel'],
+            'level' => $record['level'],
+            'message' => $record['formatted'],
+            'time' => $record['datetime']->format('U'),
+        ));
+    }
+
+    private function initialize()
+    {
+        $this->pdo->exec(
+            'CREATE TABLE IF NOT EXISTS monolog '
+            .'(channel VARCHAR(255), level INTEGER, message LONGTEXT, time INTEGER UNSIGNED)'
+        );
+        $this->statement = $this->pdo->prepare(
+            'INSERT INTO monolog (channel, level, message, time) VALUES (:channel, :level, :message, :time)'
+        );
+
+        $this->initialized = true;
+    }
+}
+```
+
+You can now use this handler in your logger:
+
+```php
+<?php
+
+$logger->pushHandler(new PDOHandler(new PDO('sqlite:logs.sqlite'));
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+```
+
+The `Monolog\Handler\AbstractProcessingHandler` class provides most of the
+logic needed for the handler, including the use of processors and the formatting
+of the record (which is why we use ``$record['formatted']`` instead of ``$record['message']``).

vendor/monolog/monolog/doc/sockets.md

@@ -0,0 +1,37 @@
+Sockets Handler
+===============
+
+This handler allows you to write your logs to sockets using [fsockopen](http://php.net/fsockopen)
+or [pfsockopen](http://php.net/pfsockopen).
+
+Persistent sockets are mainly useful in web environments where you gain some performance not closing/opening
+the connections between requests.
+
+Basic Example
+-------------
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\SocketHandler;
+
+// Create the logger
+$logger = new Logger('my_logger');
+
+// Create the handler
+$handler = new SocketHandler('unix:///var/log/httpd_app_log.socket');
+$handler->setPersistent(true);
+
+// Now add the handler
+$logger->pushHandler($handler, Logger::DEBUG);
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+
+```
+
+In this example, using syslog-ng, you should see the log on the log server:
+
+    cweb1 [2012-02-26 00:12:03] my_logger.INFO: My logger is now ready [] []
+

vendor/monolog/monolog/doc/usage.md

@@ -0,0 +1,158 @@
+Using Monolog
+=============
+
+Installation
+------------
+
+Monolog is available on Packagist ([monolog/monolog](http://packagist.org/packages/monolog/monolog))
+and as such installable via [Composer](http://getcomposer.org/).
+
+If you do not use Composer, you can grab the code from GitHub, and use any
+PSR-0 compatible autoloader (e.g. the [Symfony2 ClassLoader component](https://github.com/symfony/ClassLoader))
+to load Monolog classes.
+
+Configuring a logger
+--------------------
+
+Here is a basic setup to log to a file and to firephp on the DEBUG level:
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\FirePHPHandler;
+
+// Create the logger
+$logger = new Logger('my_logger');
+// Now add some handlers
+$logger->pushHandler(new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG));
+$logger->pushHandler(new FirePHPHandler());
+
+// You can now use your logger
+$logger->addInfo('My logger is now ready');
+```
+
+Let's explain it. The first step is to create the logger instance which will
+be used in your code. The argument is a channel name, which is useful when
+you use several loggers (see below for more details about it).
+
+The logger itself does not know how to handle a record. It delegates it to
+some handlers. The code above registers two handlers in the stack to allow
+handling records in two different ways.
+
+Note that the FirePHPHandler is called first as it is added on top of the
+stack. This allows you to temporarily add a logger with bubbling disabled if
+you want to override other configured loggers.
+
+Adding extra data in the records
+--------------------------------
+
+Monolog provides two different ways to add extra informations along the simple
+textual message.
+
+### Using the logging context
+
+The first way is the context, allowing to pass an array of data along the
+record:
+
+```php
+<?php
+
+$logger->addInfo('Adding a new user', array('username' => 'Seldaek'));
+```
+
+Simple handlers (like the StreamHandler for instance) will simply format
+the array to a string but richer handlers can take advantage of the context
+(FirePHP is able to display arrays in pretty way for instance).
+
+### Using processors
+
+The second way is to add extra data for all records by using a processor.
+Processors can be any callable. They will get the record as parameter and
+must return it after having eventually changed the `extra` part of it. Let's
+write a processor adding some dummy data in the record:
+
+```php
+<?php
+
+$logger->pushProcessor(function ($record) {
+    $record['extra']['dummy'] = 'Hello world!';
+
+    return $record;
+});
+```
+
+Monolog provides some built-in processors that can be used in your project.
+Look at the README file for the list.
+
+> Tip: processors can also be registered on a specific handler instead of
+  the logger to apply only for this handler.
+
+Leveraging channels
+-------------------
+
+Channels are a great way to identify to which part of the application a record
+is related. This is useful in big applications (and is leveraged by
+MonologBundle in Symfony2).
+
+Picture two loggers sharing a handler that writes to a single log file.
+Channels would allow you to identify the logger that issued every record.
+You can easily grep through the log files filtering this or that channel.
+
+```php
+<?php
+
+use Monolog\Logger;
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\FirePHPHandler;
+
+// Create some handlers
+$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
+$firephp = new FirePHPHandler();
+
+// Create the main logger of the app
+$logger = new Logger('my_logger');
+$logger->pushHandler($stream);
+$logger->pushHandler($firephp);
+
+// Create a logger for the security-related stuff with a different channel
+$securityLogger = new Logger('security');
+$securityLogger->pushHandler($stream);
+$securityLogger->pushHandler($firephp);
+```
+
+Customizing log format
+----------------------
+
+In Monolog it's easy to customize the format of the logs written into files,
+sockets, mails, databases and other handlers. Most of the handlers use the
+
+```php
+$record['formatted']
+```
+
+value to be automatically put into the log device. This value depends on the
+formatter settings. You can choose between predefined formatter classes or
+write your own (e.g. a multiline text file for human-readable output).
+
+To configure a predefined formatter class, just set it as the handler's field:
+
+```php
+// the default date format is "Y-m-d H:i:s"
+$dateFormat = "Y n j, g:i a";
+// the default output format is "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n"
+$output = "%datetime% > %level_name% > %message% %context% %extra%\n";
+// finally, create a formatter
+$formatter = new LineFormatter($output, $dateFormat);
+
+// Create a handler
+$stream = new StreamHandler(__DIR__.'/my_app.log', Logger::DEBUG);
+$stream->setFormatter($formatter);
+// bind it to a logger object
+$securityLogger = new Logger('security');
+$securityLogger->pushHandler($stream);
+```
+
+You may also reuse the same formatter between multiple handlers and share those
+handlers between multiple loggers.

vendor/monolog/monolog/phpunit.xml.dist

@@ -0,0 +1,15 @@
+<?xml version="1.0" encoding="UTF-8"?>
+
+<phpunit bootstrap="tests/bootstrap.php" colors="true">
+    <testsuites>
+        <testsuite name="Monolog Test Suite">
+            <directory>tests/Monolog/</directory>
+        </testsuite>
+    </testsuites>
+
+    <filter>
+        <whitelist>
+            <directory suffix=".php">src/Monolog/</directory>
+        </whitelist>
+    </filter>
+</phpunit>

vendor/monolog/monolog/src/Monolog/ErrorHandler.php

@@ -0,0 +1,204 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Psr\Log\LoggerInterface;
+use Psr\Log\LogLevel;
+
+/**
+ * Monolog error handler
+ *
+ * A facility to enable logging of runtime errors, exceptions and fatal errors.
+ *
+ * Quick setup: <code>ErrorHandler::register($logger);</code>
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class ErrorHandler
+{
+    private $logger;
+
+    private $previousExceptionHandler;
+    private $uncaughtExceptionLevel;
+
+    private $previousErrorHandler;
+    private $errorLevelMap;
+
+    private $fatalLevel;
+    private $reservedMemory;
+    private static $fatalErrors = array(E_ERROR, E_PARSE, E_CORE_ERROR, E_COMPILE_ERROR, E_USER_ERROR);
+
+    public function __construct(LoggerInterface $logger)
+    {
+        $this->logger = $logger;
+    }
+
+    /**
+     * Registers a new ErrorHandler for a given Logger
+     *
+     * By default it will handle errors, exceptions and fatal errors
+     *
+     * @param  LoggerInterface $logger
+     * @param  array|false     $errorLevelMap  an array of E_* constant to LogLevel::* constant mapping, or false to disable error handling
+     * @param  int|false       $exceptionLevel a LogLevel::* constant, or false to disable exception handling
+     * @param  int|false       $fatalLevel     a LogLevel::* constant, or false to disable fatal error handling
+     * @return ErrorHandler
+     */
+    public static function register(LoggerInterface $logger, $errorLevelMap = array(), $exceptionLevel = null, $fatalLevel = null)
+    {
+        $handler = new static($logger);
+        if ($errorLevelMap !== false) {
+            $handler->registerErrorHandler($errorLevelMap);
+        }
+        if ($exceptionLevel !== false) {
+            $handler->registerExceptionHandler($exceptionLevel);
+        }
+        if ($fatalLevel !== false) {
+            $handler->registerFatalHandler($fatalLevel);
+        }
+
+        return $handler;
+    }
+
+    public function registerExceptionHandler($level = null, $callPrevious = true)
+    {
+        $prev = set_exception_handler(array($this, 'handleException'));
+        $this->uncaughtExceptionLevel = $level === null ? LogLevel::ERROR : $level;
+        if ($callPrevious && $prev) {
+            $this->previousExceptionHandler = $prev;
+        }
+    }
+
+    public function registerErrorHandler(array $levelMap = array(), $callPrevious = true, $errorTypes = -1)
+    {
+        $prev = set_error_handler(array($this, 'handleError'), $errorTypes);
+        $this->errorLevelMap = array_replace($this->defaultErrorLevelMap(), $levelMap);
+        if ($callPrevious) {
+            $this->previousErrorHandler = $prev ?: true;
+        }
+    }
+
+    public function registerFatalHandler($level = null, $reservedMemorySize = 20)
+    {
+        register_shutdown_function(array($this, 'handleFatalError'));
+
+        $this->reservedMemory = str_repeat(' ', 1024 * $reservedMemorySize);
+        $this->fatalLevel = $level === null ? LogLevel::ALERT : $level;
+    }
+
+    protected function defaultErrorLevelMap()
+    {
+        return array(
+            E_ERROR             => LogLevel::CRITICAL,
+            E_WARNING           => LogLevel::WARNING,
+            E_PARSE             => LogLevel::ALERT,
+            E_NOTICE            => LogLevel::NOTICE,
+            E_CORE_ERROR        => LogLevel::CRITICAL,
+            E_CORE_WARNING      => LogLevel::WARNING,
+            E_COMPILE_ERROR     => LogLevel::ALERT,
+            E_COMPILE_WARNING   => LogLevel::WARNING,
+            E_USER_ERROR        => LogLevel::ERROR,
+            E_USER_WARNING      => LogLevel::WARNING,
+            E_USER_NOTICE       => LogLevel::NOTICE,
+            E_STRICT            => LogLevel::NOTICE,
+            E_RECOVERABLE_ERROR => LogLevel::ERROR,
+            E_DEPRECATED        => LogLevel::NOTICE,
+            E_USER_DEPRECATED   => LogLevel::NOTICE,
+        );
+    }
+
+    /**
+     * @private
+     */
+    public function handleException(\Exception $e)
+    {
+        $this->logger->log($this->uncaughtExceptionLevel, 'Uncaught exception', array('exception' => $e));
+
+        if ($this->previousExceptionHandler) {
+            call_user_func($this->previousExceptionHandler, $e);
+        }
+    }
+
+    /**
+     * @private
+     */
+    public function handleError($code, $message, $file = '', $line = 0, $context = array())
+    {
+        if (!(error_reporting() & $code)) {
+            return;
+        }
+
+        $level = isset($this->errorLevelMap[$code]) ? $this->errorLevelMap[$code] : LogLevel::CRITICAL;
+        $this->logger->log($level, self::codeToString($code).': '.$message, array('file' => $file, 'line' => $line));
+
+        if ($this->previousErrorHandler === true) {
+            return false;
+        } elseif ($this->previousErrorHandler) {
+            return call_user_func($this->previousErrorHandler, $code, $message, $file, $line, $context);
+        }
+    }
+
+    /**
+     * @private
+     */
+    public function handleFatalError()
+    {
+        $this->reservedMemory = null;
+
+        $lastError = error_get_last();
+        if ($lastError && in_array($lastError['type'], self::$fatalErrors)) {
+            $this->logger->log(
+                $this->fatalLevel,
+                'Fatal Error ('.self::codeToString($lastError['type']).'): '.$lastError['message'],
+                array('file' => $lastError['file'], 'line' => $lastError['line'])
+            );
+        }
+    }
+
+    private static function codeToString($code)
+    {
+        switch ($code) {
+            case E_ERROR:
+                return 'E_ERROR';
+            case E_WARNING:
+                return 'E_WARNING';
+            case E_PARSE:
+                return 'E_PARSE';
+            case E_NOTICE:
+                return 'E_NOTICE';
+            case E_CORE_ERROR:
+                return 'E_CORE_ERROR';
+            case E_CORE_WARNING:
+                return 'E_CORE_WARNING';
+            case E_COMPILE_ERROR:
+                return 'E_COMPILE_ERROR';
+            case E_COMPILE_WARNING:
+                return 'E_COMPILE_WARNING';
+            case E_USER_ERROR:
+                return 'E_USER_ERROR';
+            case E_USER_WARNING:
+                return 'E_USER_WARNING';
+            case E_USER_NOTICE:
+                return 'E_USER_NOTICE';
+            case E_STRICT:
+                return 'E_STRICT';
+            case E_RECOVERABLE_ERROR:
+                return 'E_RECOVERABLE_ERROR';
+            case E_DEPRECATED:
+                return 'E_DEPRECATED';
+            case E_USER_DEPRECATED:
+                return 'E_USER_DEPRECATED';
+        }
+
+        return 'Unknown PHP error';
+    }
+}

vendor/monolog/monolog/src/Monolog/Formatter/ChromePHPFormatter.php

@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Formats a log message according to the ChromePHP array format
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class ChromePHPFormatter implements FormatterInterface
+{
+    /**
+     * Translates Monolog log levels to Wildfire levels.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => 'log',
+        Logger::INFO      => 'info',
+        Logger::NOTICE    => 'info',
+        Logger::WARNING   => 'warn',
+        Logger::ERROR     => 'error',
+        Logger::CRITICAL  => 'error',
+        Logger::ALERT     => 'error',
+        Logger::EMERGENCY => 'error',
+    );
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        // Retrieve the line and file if set and remove them from the formatted extra
+        $backtrace = 'unknown';
+        if (isset($record['extra']['file']) && isset($record['extra']['line'])) {
+            $backtrace = $record['extra']['file'].' : '.$record['extra']['line'];
+            unset($record['extra']['file']);
+            unset($record['extra']['line']);
+        }
+
+        $message = array('message' => $record['message']);
+        if ($record['context']) {
+            $message['context'] = $record['context'];
+        }
+        if ($record['extra']) {
+            $message['extra'] = $record['extra'];
+        }
+        if (count($message) === 1) {
+            $message = reset($message);
+        }
+
+        return array(
+            $record['channel'],
+            $message,
+            $backtrace,
+            $this->logLevels[$record['level']],
+        );
+    }
+
+    public function formatBatch(array $records)
+    {
+        $formatted = array();
+
+        foreach ($records as $record) {
+            $formatted[] = $this->format($record);
+        }
+
+        return $formatted;
+    }
+}

vendor/monolog/monolog/src/Monolog/Formatter/FormatterInterface.php

@@ -0,0 +1,36 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Interface for formatters
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+interface FormatterInterface
+{
+    /**
+     * Formats a log record.
+     *
+     * @param  array $record A record to format
+     * @return mixed The formatted record
+     */
+    public function format(array $record);
+
+    /**
+     * Formats a set of log records.
+     *
+     * @param  array $records A set of records to format
+     * @return mixed The formatted set of records
+     */
+    public function formatBatch(array $records);
+}

vendor/monolog/monolog/src/Monolog/Formatter/GelfMessageFormatter.php

@@ -0,0 +1,94 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Gelf\Message;
+
+/**
+ * Serializes a log message to GELF
+ * @see http://www.graylog2.org/about/gelf
+ *
+ * @author Matt Lehner <mlehner@gmail.com>
+ */
+class GelfMessageFormatter extends NormalizerFormatter
+{
+    /**
+     * @var string the name of the system for the Gelf log message
+     */
+    protected $systemName;
+
+    /**
+     * @var string a prefix for 'extra' fields from the Monolog record (optional)
+     */
+    protected $extraPrefix;
+
+    /**
+     * @var string a prefix for 'context' fields from the Monolog record (optional)
+     */
+    protected $contextPrefix;
+
+    /**
+     * Translates Monolog log levels to Graylog2 log priorities.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => 7,
+        Logger::INFO      => 6,
+        Logger::NOTICE    => 5,
+        Logger::WARNING   => 4,
+        Logger::ERROR     => 3,
+        Logger::CRITICAL  => 2,
+        Logger::ALERT     => 1,
+        Logger::EMERGENCY => 0,
+    );
+
+    public function __construct($systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_')
+    {
+        parent::__construct('U.u');
+
+        $this->systemName = $systemName ?: gethostname();
+
+        $this->extraPrefix = $extraPrefix;
+        $this->contextPrefix = $contextPrefix;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $record = parent::format($record);
+        $message = new Message();
+        $message
+            ->setTimestamp($record['datetime'])
+            ->setShortMessage((string) $record['message'])
+            ->setFacility($record['channel'])
+            ->setHost($this->systemName)
+            ->setLine(isset($record['extra']['line']) ? $record['extra']['line'] : null)
+            ->setFile(isset($record['extra']['file']) ? $record['extra']['file'] : null)
+            ->setLevel($this->logLevels[$record['level']]);
+
+        // Do not duplicate these values in the additional fields
+        unset($record['extra']['line']);
+        unset($record['extra']['file']);
+
+        foreach ($record['extra'] as $key => $val) {
+            $message->setAdditional($this->extraPrefix . $key, is_scalar($val) ? $val : $this->toJson($val));
+        }
+
+        foreach ($record['context'] as $key => $val) {
+            $message->setAdditional($this->contextPrefix . $key, is_scalar($val) ? $val : $this->toJson($val));
+        }
+
+        return $message;
+    }
+}

vendor/monolog/monolog/src/Monolog/Formatter/JsonFormatter.php

@@ -0,0 +1,38 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Encodes whatever record data is passed to it as json
+ *
+ * This can be useful to log to databases or remote APIs
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class JsonFormatter implements FormatterInterface
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        return json_encode($record);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function formatBatch(array $records)
+    {
+        return json_encode($records);
+    }
+}

vendor/monolog/monolog/src/Monolog/Formatter/LineFormatter.php

@@ -0,0 +1,102 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Formats incoming records into a one-line string
+ *
+ * This is especially useful for logging to files
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class LineFormatter extends NormalizerFormatter
+{
+    const SIMPLE_FORMAT = "[%datetime%] %channel%.%level_name%: %message% %context% %extra%\n";
+
+    protected $format;
+
+    /**
+     * @param string $format     The format of the message
+     * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+     */
+    public function __construct($format = null, $dateFormat = null)
+    {
+        $this->format = $format ?: static::SIMPLE_FORMAT;
+        parent::__construct($dateFormat);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $vars = parent::format($record);
+
+        $output = $this->format;
+        foreach ($vars['extra'] as $var => $val) {
+            if (false !== strpos($output, '%extra.'.$var.'%')) {
+                $output = str_replace('%extra.'.$var.'%', $this->convertToString($val), $output);
+                unset($vars['extra'][$var]);
+            }
+        }
+        foreach ($vars as $var => $val) {
+            $output = str_replace('%'.$var.'%', $this->convertToString($val), $output);
+        }
+
+        return $output;
+    }
+
+    public function formatBatch(array $records)
+    {
+        $message = '';
+        foreach ($records as $record) {
+            $message .= $this->format($record);
+        }
+
+        return $message;
+    }
+
+    protected function normalize($data)
+    {
+        if (is_bool($data) || is_null($data)) {
+            return var_export($data, true);
+        }
+
+        if ($data instanceof \Exception) {
+            $previousText = '';
+            if ($previous = $data->getPrevious()) {
+                do {
+                    $previousText .= ', '.get_class($previous).': '.$previous->getMessage().' at '.$previous->getFile().':'.$previous->getLine();
+                } while ($previous = $previous->getPrevious());
+            }
+
+            return '[object] ('.get_class($data).': '.$data->getMessage().' at '.$data->getFile().':'.$data->getLine().$previousText.')';
+        }
+
+        return parent::normalize($data);
+    }
+
+    protected function convertToString($data)
+    {
+        if (null === $data || is_scalar($data)) {
+            return (string) $data;
+        }
+
+        $data = $this->normalize($data);
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return $this->toJson($data);
+        }
+
+        return str_replace('\\/', '/', json_encode($data));
+    }
+}

vendor/monolog/monolog/src/Monolog/Formatter/LogstashFormatter.php

@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * Serializes a log message to Logstash Event Format
+ *
+ * @see http://logstash.net/
+ * @see https://github.com/logstash/logstash/blob/master/lib/logstash/event.rb
+ *
+ * @author Tim Mower <timothy.mower@gmail.com>
+ */
+class LogstashFormatter extends NormalizerFormatter
+{
+    /**
+     * @var string the name of the system for the Logstash log message, used to fill the @source field
+     */
+    protected $systemName;
+
+    /**
+     * @var string an application name for the Logstash log message, used to fill the @type field
+     */
+    protected $applicationName;
+
+    /**
+     * @var string a prefix for 'extra' fields from the Monolog record (optional)
+     */
+    protected $extraPrefix;
+
+    /**
+     * @var string a prefix for 'context' fields from the Monolog record (optional)
+     */
+    protected $contextPrefix;
+
+    /**
+     * @param string $applicationName the application that sends the data, used as the "type" field of logstash
+     * @param string $systemName      the system/machine name, used as the "source" field of logstash, defaults to the hostname of the machine
+     * @param string $extraPrefix     prefix for extra keys inside logstash "fields"
+     * @param string $contextPrefix   prefix for context keys inside logstash "fields", defaults to ctxt_
+     */
+    public function __construct($applicationName, $systemName = null, $extraPrefix = null, $contextPrefix = 'ctxt_')
+    {
+        //log stash requires a ISO 8601 format date
+        parent::__construct('c');
+
+        $this->systemName = $systemName ?: gethostname();
+        $this->applicationName = $applicationName;
+
+        $this->extraPrefix = $extraPrefix;
+        $this->contextPrefix = $contextPrefix;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        $record = parent::format($record);
+        $message = array(
+            '@timestamp' => $record['datetime'],
+            '@message' => $record['message'],
+            '@tags' => array($record['channel']),
+            '@source' => $this->systemName
+        );
+
+        if ($this->applicationName) {
+            $message['@type'] = $this->applicationName;
+        }
+        $message['@fields'] = array();
+        $message['@fields']['channel'] = $record['channel'];
+        $message['@fields']['level'] = $record['level'];
+
+        if (isset($record['extra']['server'])) {
+            $message['@source_host'] = $record['extra']['server'];
+        }
+        if (isset($record['extra']['url'])) {
+            $message['@source_path'] = $record['extra']['url'];
+        }
+        foreach ($record['extra'] as $key => $val) {
+            $message['@fields'][$this->extraPrefix . $key] = $val;
+        }
+
+        foreach ($record['context'] as $key => $val) {
+            $message['@fields'][$this->contextPrefix . $key] = $val;
+        }
+
+        return json_encode($message) . "\n";
+    }
+}

vendor/monolog/monolog/src/Monolog/Formatter/NormalizerFormatter.php

@@ -0,0 +1,137 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Exception;
+
+/**
+ * Normalizes incoming records to remove objects/resources so it's easier to dump to various targets
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class NormalizerFormatter implements FormatterInterface
+{
+    const SIMPLE_DATE = "Y-m-d H:i:s";
+
+    protected $dateFormat;
+
+    /**
+     * @param string $dateFormat The format of the timestamp: one supported by DateTime::format
+     */
+    public function __construct($dateFormat = null)
+    {
+        $this->dateFormat = $dateFormat ?: static::SIMPLE_DATE;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        return $this->normalize($record);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function formatBatch(array $records)
+    {
+        foreach ($records as $key => $record) {
+            $records[$key] = $this->format($record);
+        }
+
+        return $records;
+    }
+
+    protected function normalize($data)
+    {
+        if (null === $data || is_scalar($data)) {
+            return $data;
+        }
+
+        if (is_array($data) || $data instanceof \Traversable) {
+            $normalized = array();
+
+            $count = 1;
+            foreach ($data as $key => $value) {
+                if ($count++ >= 1000) {
+                    $normalized['...'] = 'Over 1000 items, aborting normalization';
+                    break;
+                }
+                $normalized[$key] = $this->normalize($value);
+            }
+
+            return $normalized;
+        }
+
+        if ($data instanceof \DateTime) {
+            return $data->format($this->dateFormat);
+        }
+
+        if (is_object($data)) {
+            if ($data instanceof Exception) {
+                return $this->normalizeException($data);
+            }
+
+            return sprintf("[object] (%s: %s)", get_class($data), $this->toJson($data, true));
+        }
+
+        if (is_resource($data)) {
+            return '[resource]';
+        }
+
+        return '[unknown('.gettype($data).')]';
+    }
+
+    protected function normalizeException(Exception $e)
+    {
+        $data = array(
+            'class' => get_class($e),
+            'message' => $e->getMessage(),
+            'file' => $e->getFile().':'.$e->getLine(),
+        );
+
+        $trace = $e->getTrace();
+        array_shift($trace);
+        foreach ($trace as $frame) {
+            if (isset($frame['file'])) {
+                $data['trace'][] = $frame['file'].':'.$frame['line'];
+            } else {
+                $data['trace'][] = json_encode($frame);
+            }
+        }
+
+        if ($previous = $e->getPrevious()) {
+            $data['previous'] = $this->normalizeException($previous);
+        }
+
+        return $data;
+    }
+
+    protected function toJson($data, $ignoreErrors = false)
+    {
+        // suppress json_encode errors since it's twitchy with some inputs
+        if ($ignoreErrors) {
+            if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+                return @json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+            }
+
+            return @json_encode($data);
+        }
+
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+        }
+
+        return json_encode($data);
+    }
+}

vendor/monolog/monolog/src/Monolog/Formatter/WildfireFormatter.php

@@ -0,0 +1,102 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * Serializes a log message according to Wildfire's header requirements
+ *
+ * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com>
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Kirill chEbba Chebunin <iam@chebba.org>
+ */
+class WildfireFormatter extends NormalizerFormatter
+{
+    /**
+     * Translates Monolog log levels to Wildfire levels.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => 'LOG',
+        Logger::INFO      => 'INFO',
+        Logger::NOTICE    => 'INFO',
+        Logger::WARNING   => 'WARN',
+        Logger::ERROR     => 'ERROR',
+        Logger::CRITICAL  => 'ERROR',
+        Logger::ALERT     => 'ERROR',
+        Logger::EMERGENCY => 'ERROR',
+    );
+
+    /**
+     * {@inheritdoc}
+     */
+    public function format(array $record)
+    {
+        // Retrieve the line and file if set and remove them from the formatted extra
+        $file = $line = '';
+        if (isset($record['extra']['file'])) {
+            $file = $record['extra']['file'];
+            unset($record['extra']['file']);
+        }
+        if (isset($record['extra']['line'])) {
+            $line = $record['extra']['line'];
+            unset($record['extra']['line']);
+        }
+
+        $record = $this->normalize($record);
+        $message = array('message' => $record['message']);
+        $handleError = false;
+        if ($record['context']) {
+            $message['context'] = $record['context'];
+            $handleError = true;
+        }
+        if ($record['extra']) {
+            $message['extra'] = $record['extra'];
+            $handleError = true;
+        }
+        if (count($message) === 1) {
+            $message = reset($message);
+        }
+
+        // Create JSON object describing the appearance of the message in the console
+        $json = $this->toJson(array(
+            array(
+                'Type'  => $this->logLevels[$record['level']],
+                'File'  => $file,
+                'Line'  => $line,
+                'Label' => $record['channel'],
+            ),
+            $message,
+        ), $handleError);
+
+        // The message itself is a serialization of the above JSON object + it's length
+        return sprintf(
+            '%s|%s|',
+            strlen($json),
+            $json
+        );
+    }
+
+    public function formatBatch(array $records)
+    {
+        throw new \BadMethodCallException('Batch formatting does not make sense for the WildfireFormatter');
+    }
+
+    protected function normalize($data)
+    {
+        if (is_object($data) && !$data instanceof \DateTime) {
+            return $data;
+        }
+
+        return parent::normalize($data);
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/AbstractHandler.php

@@ -0,0 +1,184 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+abstract class AbstractHandler implements HandlerInterface
+{
+    protected $level = Logger::DEBUG;
+    protected $bubble = true;
+
+    /**
+     * @var FormatterInterface
+     */
+    protected $formatter;
+    protected $processors = array();
+
+    /**
+     * @param integer $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($level = Logger::DEBUG, $bubble = true)
+    {
+        $this->level = $level;
+        $this->bubble = $bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        return $record['level'] >= $this->level;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        foreach ($records as $record) {
+            $this->handle($record);
+        }
+    }
+
+    /**
+     * Closes the handler.
+     *
+     * This will be called automatically when the object is destroyed
+     */
+    public function close()
+    {
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function pushProcessor($callback)
+    {
+        if (!is_callable($callback)) {
+            throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+        }
+        array_unshift($this->processors, $callback);
+
+        return $this;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function popProcessor()
+    {
+        if (!$this->processors) {
+            throw new \LogicException('You tried to pop from an empty processor stack.');
+        }
+
+        return array_shift($this->processors);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function setFormatter(FormatterInterface $formatter)
+    {
+        $this->formatter = $formatter;
+
+        return $this;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getFormatter()
+    {
+        if (!$this->formatter) {
+            $this->formatter = $this->getDefaultFormatter();
+        }
+
+        return $this->formatter;
+    }
+
+    /**
+     * Sets minimum logging level at which this handler will be triggered.
+     *
+     * @param  integer $level
+     * @return self
+     */
+    public function setLevel($level)
+    {
+        $this->level = $level;
+
+        return $this;
+    }
+
+    /**
+     * Gets minimum logging level at which this handler will be triggered.
+     *
+     * @return integer
+     */
+    public function getLevel()
+    {
+        return $this->level;
+    }
+
+    /**
+     * Sets the bubbling behavior.
+     *
+     * @param Boolean $bubble true means that this handler allows bubbling.
+     *                        false means that bubbling is not permitted.
+     * @return self
+     */
+    public function setBubble($bubble)
+    {
+        $this->bubble = $bubble;
+
+        return $this;
+    }
+
+    /**
+     * Gets the bubbling behavior.
+     *
+     * @return Boolean true means that this handler allows bubbling.
+     *                 false means that bubbling is not permitted.
+     */
+    public function getBubble()
+    {
+        return $this->bubble;
+    }
+
+    public function __destruct()
+    {
+        try {
+            $this->close();
+        } catch (\Exception $e) {
+            // do nothing
+        }
+    }
+
+    /**
+     * Gets the default formatter.
+     *
+     * @return FormatterInterface
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter();
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/AbstractProcessingHandler.php

@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base Handler class providing the Handler structure
+ *
+ * Classes extending it should (in most cases) only implement write($record)
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+abstract class AbstractProcessingHandler extends AbstractHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($record['level'] < $this->level) {
+            return false;
+        }
+
+        $record = $this->processRecord($record);
+
+        $record['formatted'] = $this->getFormatter()->format($record);
+
+        $this->write($record);
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * Writes the record down to the log of the implementing handler
+     *
+     * @param  array $record
+     * @return void
+     */
+    abstract protected function write(array $record);
+
+    /**
+     * Processes a record.
+     *
+     * @param  array $record
+     * @return array
+     */
+    protected function processRecord(array $record)
+    {
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        return $record;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/AmqpHandler.php

@@ -0,0 +1,69 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\JsonFormatter;
+
+class AmqpHandler extends AbstractProcessingHandler
+{
+    /**
+     * @var \AMQPExchange $exchange
+     */
+    protected $exchange;
+
+    /**
+     * @param \AMQPExchange $exchange     AMQP exchange, ready for use
+     * @param string        $exchangeName
+     * @param int           $level
+     * @param bool          $bubble       Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(\AMQPExchange $exchange, $exchangeName = 'log', $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->exchange = $exchange;
+        $this->exchange->setName($exchangeName);
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        $data = $record["formatted"];
+
+        $routingKey = sprintf(
+            '%s.%s',
+            substr($record['level_name'], 0, 4),
+            $record['channel']
+        );
+
+        $this->exchange->publish(
+            $data,
+            strtolower($routingKey),
+            0,
+            array(
+                'delivery_mode' => 2,
+                'Content-type' => 'application/json'
+            )
+        );
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new JsonFormatter();
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/BufferHandler.php

@@ -0,0 +1,98 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Buffers all records until closing the handler and then pass them as batch.
+ *
+ * This is useful for a MailHandler to send only one mail per request instead of
+ * sending one per log message.
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class BufferHandler extends AbstractHandler
+{
+    protected $handler;
+    protected $bufferSize = 0;
+    protected $bufferLimit;
+    protected $flushOnOverflow;
+    protected $buffer = array();
+
+    /**
+     * @param HandlerInterface $handler         Handler.
+     * @param integer          $bufferLimit     How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+     * @param integer          $level           The minimum logging level at which this handler will be triggered
+     * @param Boolean          $bubble          Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean          $flushOnOverflow If true, the buffer is flushed when the max size has been reached, by default oldest entries are discarded
+     */
+    public function __construct(HandlerInterface $handler, $bufferLimit = 0, $level = Logger::DEBUG, $bubble = true, $flushOnOverflow = false)
+    {
+        parent::__construct($level, $bubble);
+        $this->handler = $handler;
+        $this->bufferLimit = (int) $bufferLimit;
+        $this->flushOnOverflow = $flushOnOverflow;
+
+        // __destructor() doesn't get called on Fatal errors
+        register_shutdown_function(array($this, 'close'));
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($record['level'] < $this->level) {
+            return false;
+        }
+
+        if ($this->bufferLimit > 0 && $this->bufferSize === $this->bufferLimit) {
+            if ($this->flushOnOverflow) {
+                $this->flush();
+            } else {
+                array_shift($this->buffer);
+                $this->bufferSize--;
+            }
+        }
+
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        $this->buffer[] = $record;
+        $this->bufferSize++;
+
+        return false === $this->bubble;
+    }
+
+    public function flush()
+    {
+        if ($this->bufferSize === 0) {
+            return;
+        }
+
+        $this->handler->handleBatch($this->buffer);
+        $this->bufferSize = 0;
+        $this->buffer = array();
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        $this->flush();
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/ChromePHPHandler.php

@@ -0,0 +1,183 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ChromePHPFormatter;
+use Monolog\Logger;
+
+/**
+ * Handler sending logs to the ChromePHP extension (http://www.chromephp.com/)
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class ChromePHPHandler extends AbstractProcessingHandler
+{
+    /**
+     * Version of the extension
+     */
+    const VERSION = '4.0';
+
+    /**
+     * Header name
+     */
+    const HEADER_NAME = 'X-ChromeLogger-Data';
+
+    protected static $initialized = false;
+
+    /**
+     * Tracks whether we sent too much data
+     *
+     * Chrome limits the headers to 256KB, so when we sent 240KB we stop sending
+     *
+     * @var Boolean
+     */
+    protected static $overflowed = false;
+
+    protected static $json = array(
+        'version' => self::VERSION,
+        'columns' => array('label', 'log', 'backtrace', 'type'),
+        'rows' => array(),
+    );
+
+    protected static $sendHeaders = true;
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $messages = array();
+
+        foreach ($records as $record) {
+            if ($record['level'] < $this->level) {
+                continue;
+            }
+            $messages[] = $this->processRecord($record);
+        }
+
+        if (!empty($messages)) {
+            $messages = $this->getFormatter()->formatBatch($messages);
+            self::$json['rows'] = array_merge(self::$json['rows'], $messages);
+            $this->send();
+        }
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new ChromePHPFormatter();
+    }
+
+    /**
+     * Creates & sends header for a record
+     *
+     * @see sendHeader()
+     * @see send()
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        self::$json['rows'][] = $record['formatted'];
+
+        $this->send();
+    }
+
+    /**
+     * Sends the log header
+     *
+     * @see sendHeader()
+     */
+    protected function send()
+    {
+        if (self::$overflowed) {
+            return;
+        }
+
+        if (!self::$initialized) {
+            self::$sendHeaders = $this->headersAccepted();
+            self::$json['request_uri'] = isset($_SERVER['REQUEST_URI']) ? $_SERVER['REQUEST_URI'] : '';
+
+            self::$initialized = true;
+        }
+
+        $json = @json_encode(self::$json);
+        $data = base64_encode(utf8_encode($json));
+        if (strlen($data) > 240*1024) {
+            self::$overflowed = true;
+
+            $record = array(
+                'message' => 'Incomplete logs, chrome header size limit reached',
+                'context' => array(),
+                'level' => Logger::WARNING,
+                'level_name' => Logger::getLevelName(Logger::WARNING),
+                'channel' => 'monolog',
+                'datetime' => new \DateTime(),
+                'extra' => array(),
+            );
+            self::$json['rows'][count(self::$json['rows']) - 1] = $this->getFormatter()->format($record);
+            $json = @json_encode(self::$json);
+            $data = base64_encode(utf8_encode($json));
+        }
+
+        $this->sendHeader(self::HEADER_NAME, $data);
+    }
+
+    /**
+     * Send header string to the client
+     *
+     * @param string $header
+     * @param string $content
+     */
+    protected function sendHeader($header, $content)
+    {
+        if (!headers_sent() && self::$sendHeaders) {
+            header(sprintf('%s: %s', $header, $content));
+        }
+    }
+
+    /**
+     * Verifies if the headers are accepted by the current user agent
+     *
+     * @return Boolean
+     */
+    protected function headersAccepted()
+    {
+        return !isset($_SERVER['HTTP_USER_AGENT'])
+               || preg_match('{\bChrome/\d+[\.\d+]*\b}', $_SERVER['HTTP_USER_AGENT']);
+    }
+
+    /**
+     * BC getter for the sendHeaders property that has been made static
+     */
+    public function __get($property)
+    {
+        if ('sendHeaders' !== $property) {
+            throw new \InvalidArgumentException('Undefined property '.$property);
+        }
+
+        return static::$sendHeaders;
+    }
+
+    /**
+     * BC setter for the sendHeaders property that has been made static
+     */
+    public function __set($property, $value)
+    {
+        if ('sendHeaders' !== $property) {
+            throw new \InvalidArgumentException('Undefined property '.$property);
+        }
+
+        static::$sendHeaders = $value;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/CouchDBHandler.php

@@ -0,0 +1,72 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\JsonFormatter;
+use Monolog\Logger;
+
+/**
+ * CouchDB handler
+ *
+ * @author Markus Bachmann <markus.bachmann@bachi.biz>
+ */
+class CouchDBHandler extends AbstractProcessingHandler
+{
+    private $options;
+
+    public function __construct(array $options = array(), $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->options = array_merge(array(
+            'host'     => 'localhost',
+            'port'     => 5984,
+            'dbname'   => 'logger',
+            'username' => null,
+            'password' => null,
+        ), $options);
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        $basicAuth = null;
+        if ($this->options['username']) {
+            $basicAuth = sprintf('%s:%s@', $this->options['username'], $this->options['password']);
+        }
+
+        $url = 'http://'.$basicAuth.$this->options['host'].':'.$this->options['port'].'/'.$this->options['dbname'];
+        $context = stream_context_create(array(
+            'http' => array(
+                'method'        => 'POST',
+                'content'       => $record['formatted'],
+                'ignore_errors' => true,
+                'max_redirects' => 0,
+                'header'        => 'Content-type: application/json',
+            )
+        ));
+
+        if (false === @file_get_contents($url, null, $context)) {
+            throw new \RuntimeException(sprintf('Could not connect to %s', $url));
+        }
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new JsonFormatter();
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/CubeHandler.php

@@ -0,0 +1,145 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Logs to Cube.
+ *
+ * @link http://square.github.com/cube/
+ * @author Wan Chen <kami@kamisama.me>
+ */
+class CubeHandler extends AbstractProcessingHandler
+{
+    private $udpConnection = null;
+    private $httpConnection = null;
+    private $scheme = null;
+    private $host = null;
+    private $port = null;
+    private $acceptedSchemes = array('http', 'udp');
+
+    /**
+     * Create a Cube handler
+     *
+     * @throws UnexpectedValueException when given url is not a valid url.
+     * A valid url must consists of three parts : protocol://host:port
+     * Only valid protocol used by Cube are http and udp
+     */
+    public function __construct($url, $level = Logger::DEBUG, $bubble = true)
+    {
+        $urlInfos = parse_url($url);
+
+        if (!isset($urlInfos['scheme']) || !isset($urlInfos['host']) || !isset($urlInfos['port'])) {
+            throw new \UnexpectedValueException('URL "'.$url.'" is not valid');
+        }
+
+        if (!in_array($urlInfos['scheme'], $this->acceptedSchemes)) {
+            throw new \UnexpectedValueException(
+                'Invalid protocol (' . $urlInfos['scheme']  . ').'
+                . ' Valid options are ' . implode(', ', $this->acceptedSchemes));
+        }
+
+        $this->scheme = $urlInfos['scheme'];
+        $this->host = $urlInfos['host'];
+        $this->port = $urlInfos['port'];
+
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * Establish a connection to an UDP socket
+     *
+     * @throws LogicException when unable to connect to the socket
+     */
+    protected function connectUdp()
+    {
+        if (!extension_loaded('sockets')) {
+            throw new MissingExtensionException('The sockets extension is required to use udp URLs with the CubeHandler');
+        }
+
+        $this->udpConnection = socket_create(AF_INET, SOCK_DGRAM, 0);
+        if (!$this->udpConnection) {
+            throw new \LogicException('Unable to create a socket');
+        }
+
+        if (!socket_connect($this->udpConnection, $this->host, $this->port)) {
+            throw new \LogicException('Unable to connect to the socket at ' . $this->host . ':' . $this->port);
+        }
+    }
+
+    /**
+     * Establish a connection to a http server
+     */
+    protected function connectHttp()
+    {
+        if (!extension_loaded('curl')) {
+            throw new \LogicException('The curl extension is needed to use http URLs with the CubeHandler');
+        }
+
+        $this->httpConnection = curl_init('http://'.$this->host.':'.$this->port.'/1.0/event/put');
+
+        if (!$this->httpConnection) {
+            throw new \LogicException('Unable to connect to ' . $this->host . ':' . $this->port);
+        }
+
+        curl_setopt($this->httpConnection, CURLOPT_CUSTOMREQUEST, "POST");
+        curl_setopt($this->httpConnection, CURLOPT_RETURNTRANSFER, true);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $date = $record['datetime'];
+
+        $data = array('time' => $date->format('Y-m-d\TH:i:s.u'));
+        unset($record['datetime']);
+
+        if (isset($record['context']['type'])) {
+            $data['type'] = $record['context']['type'];
+            unset($record['context']['type']);
+        } else {
+            $data['type'] = $record['channel'];
+        }
+
+        $data['data'] = $record['context'];
+        $data['data']['level'] = $record['level'];
+
+        $this->{'write'.$this->scheme}(json_encode($data));
+    }
+
+    private function writeUdp($data)
+    {
+        if (!$this->udpConnection) {
+            $this->connectUdp();
+        }
+
+        socket_send($this->udpConnection, $data, strlen($data), 0);
+    }
+
+    private function writeHttp($data)
+    {
+        if (!$this->httpConnection) {
+            $this->connectHttp();
+        }
+
+        curl_setopt($this->httpConnection, CURLOPT_POSTFIELDS, '['.$data.']');
+        curl_setopt($this->httpConnection, CURLOPT_HTTPHEADER, array(
+                'Content-Type: application/json',
+                'Content-Length: ' . strlen('['.$data.']'))
+        );
+
+        return curl_exec($this->httpConnection);
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/DoctrineCouchDBHandler.php

@@ -0,0 +1,45 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+use Doctrine\CouchDB\CouchDBClient;
+
+/**
+ * CouchDB handler for Doctrine CouchDB ODM
+ *
+ * @author Markus Bachmann <markus.bachmann@bachi.biz>
+ */
+class DoctrineCouchDBHandler extends AbstractProcessingHandler
+{
+    private $client;
+
+    public function __construct(CouchDBClient $client, $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->client = $client;
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        $this->client->postDocument($record['formatted']);
+    }
+
+    protected function getDefaultFormatter()
+    {
+        return new NormalizerFormatter;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/ErrorLogHandler.php

@@ -0,0 +1,63 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to PHP error_log() handler.
+ *
+ * @author Elan Ruusamäe <glen@delfi.ee>
+ */
+class ErrorLogHandler extends AbstractProcessingHandler
+{
+    const OPERATING_SYSTEM = 0;
+    const SAPI = 4;
+
+    protected $messageType;
+
+    /**
+     * @param integer $messageType Says where the error should go.
+     * @param integer $level       The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble      Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($messageType = self::OPERATING_SYSTEM, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        if (false === in_array($messageType, self::getAvailableTypes())) {
+            $message = sprintf('The given message type "%s" is not supported', print_r($messageType, true));
+            throw new \InvalidArgumentException($message);
+        }
+
+        $this->messageType = $messageType;
+    }
+
+    /**
+     * @return array With all available types
+     */
+    public static function getAvailableTypes()
+    {
+        return array(
+            self::OPERATING_SYSTEM,
+            self::SAPI,
+        );
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        error_log((string) $record['formatted'], $this->messageType);
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ActivationStrategyInterface.php

@@ -0,0 +1,28 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+/**
+ * Interface for activation strategies for the FingersCrossedHandler.
+ *
+ * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+ */
+interface ActivationStrategyInterface
+{
+    /**
+     * Returns whether the given record activates the handler.
+     *
+     * @param  array   $record
+     * @return Boolean
+     */
+    public function isHandlerActivated(array $record);
+}

vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ChannelLevelActivationStrategy.php

@@ -0,0 +1,57 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+*
+* (c) Jordi Boggiano <j.boggiano@seld.be>
+*
+* For the full copyright and license information, please view the LICENSE
+* file that was distributed with this source code.
+*/
+
+namespace Monolog\Handler\FingersCrossed;
+
+/**
+ * Channel and Error level based monolog activation strategy. Allows to trigger activation
+ * based on level per channel. e.g. trigger activation on level 'ERROR' by default, except
+ * for records of the 'sql' channel; those should trigger activation on level 'WARN'.
+ *
+ * Example:
+ *
+ * <code>
+ *   $activationStrategy = new ChannelLevelActivationStrategy(
+ *       Logger::CRITICAL,
+ *       array(
+ *           'request' => Logger::ALERT,
+ *           'sensitive' => Logger::ERROR,
+ *       )
+ *   );
+ *   $handler = new FingersCrossedHandler(new StreamHandler('php://stderr'), $activationStrategy);
+ * </code>
+ *
+ * @author Mike Meessen <netmikey@gmail.com>
+ */
+class ChannelLevelActivationStrategy implements ActivationStrategyInterface
+{
+    private $defaultActionLevel;
+    private $channelToActionLevel;
+
+    /**
+     * @param int   $defaultActionLevel    The default action level to be used if the record's category doesn't match any
+     * @param array $categoryToActionLevel An array that maps channel names to action levels.
+     */
+    public function __construct($defaultActionLevel, $channelToActionLevel = array())
+    {
+        $this->defaultActionLevel = $defaultActionLevel;
+        $this->channelToActionLevel = $channelToActionLevel;
+    }
+
+    public function isHandlerActivated(array $record)
+    {
+        if (isset($this->channelToActionLevel[$record['channel']])) {
+            return $record['level'] >= $this->channelToActionLevel[$record['channel']];
+        }
+
+        return $record['level'] >= $this->defaultActionLevel;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/FingersCrossed/ErrorLevelActivationStrategy.php

@@ -0,0 +1,32 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\FingersCrossed;
+
+/**
+ * Error level based activation strategy.
+ *
+ * @author Johannes M. Schmitt <schmittjoh@gmail.com>
+ */
+class ErrorLevelActivationStrategy implements ActivationStrategyInterface
+{
+    private $actionLevel;
+
+    public function __construct($actionLevel)
+    {
+        $this->actionLevel = $actionLevel;
+    }
+
+    public function isHandlerActivated(array $record)
+    {
+        return $record['level'] >= $this->actionLevel;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/FingersCrossedHandler.php

@@ -0,0 +1,118 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ActivationStrategyInterface;
+use Monolog\Logger;
+
+/**
+ * Buffers all records until a certain level is reached
+ *
+ * The advantage of this approach is that you don't get any clutter in your log files.
+ * Only requests which actually trigger an error (or whatever your actionLevel is) will be
+ * in the logs, but they will contain all records, not only those above the level threshold.
+ *
+ * You can find the various activation strategies in the
+ * Monolog\Handler\FingersCrossed\ namespace.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class FingersCrossedHandler extends AbstractHandler
+{
+    protected $handler;
+    protected $activationStrategy;
+    protected $buffering = true;
+    protected $bufferSize;
+    protected $buffer = array();
+    protected $stopBuffering;
+
+    /**
+     * @param callable|HandlerInterface       $handler            Handler or factory callable($record, $fingersCrossedHandler).
+     * @param int|ActivationStrategyInterface $activationStrategy Strategy which determines when this handler takes action
+     * @param int                             $bufferSize         How many entries should be buffered at most, beyond that the oldest items are removed from the buffer.
+     * @param Boolean                         $bubble             Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean                         $stopBuffering      Whether the handler should stop buffering after being triggered (default true)
+     */
+    public function __construct($handler, $activationStrategy = null, $bufferSize = 0, $bubble = true, $stopBuffering = true)
+    {
+        if (null === $activationStrategy) {
+            $activationStrategy = new ErrorLevelActivationStrategy(Logger::WARNING);
+        }
+
+        // convert simple int activationStrategy to an object
+        if (!$activationStrategy instanceof ActivationStrategyInterface) {
+            $activationStrategy = new ErrorLevelActivationStrategy($activationStrategy);
+        }
+
+        $this->handler = $handler;
+        $this->activationStrategy = $activationStrategy;
+        $this->bufferSize = $bufferSize;
+        $this->bubble = $bubble;
+        $this->stopBuffering = $stopBuffering;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        return true;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        if ($this->buffering) {
+            $this->buffer[] = $record;
+            if ($this->bufferSize > 0 && count($this->buffer) > $this->bufferSize) {
+                array_shift($this->buffer);
+            }
+            if ($this->activationStrategy->isHandlerActivated($record)) {
+                if ($this->stopBuffering) {
+                    $this->buffering = false;
+                }
+                if (!$this->handler instanceof HandlerInterface) {
+                    if (!is_callable($this->handler)) {
+                        throw new \RuntimeException("The given handler (".json_encode($this->handler).") is not a callable nor a Monolog\Handler\HandlerInterface object");
+                    }
+                    $this->handler = call_user_func($this->handler, $record, $this);
+                    if (!$this->handler instanceof HandlerInterface) {
+                        throw new \RuntimeException("The factory callable should return a HandlerInterface");
+                    }
+                }
+                $this->handler->handleBatch($this->buffer);
+                $this->buffer = array();
+            }
+        } else {
+            $this->handler->handle($record);
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * Resets the state of the handler. Stops forwarding records to the wrapped handler.
+     */
+    public function reset()
+    {
+        $this->buffering = true;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/FirePHPHandler.php

@@ -0,0 +1,184 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\WildfireFormatter;
+
+/**
+ * Simple FirePHP Handler (http://www.firephp.org/), which uses the Wildfire protocol.
+ *
+ * @author Eric Clemmons (@ericclemmons) <eric@uxdriven.com>
+ */
+class FirePHPHandler extends AbstractProcessingHandler
+{
+    /**
+     * WildFire JSON header message format
+     */
+    const PROTOCOL_URI = 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2';
+
+    /**
+     * FirePHP structure for parsing messages & their presentation
+     */
+    const STRUCTURE_URI = 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1';
+
+    /**
+     * Must reference a "known" plugin, otherwise headers won't display in FirePHP
+     */
+    const PLUGIN_URI = 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3';
+
+    /**
+     * Header prefix for Wildfire to recognize & parse headers
+     */
+    const HEADER_PREFIX = 'X-Wf';
+
+    /**
+     * Whether or not Wildfire vendor-specific headers have been generated & sent yet
+     */
+    protected static $initialized = false;
+
+    /**
+     * Shared static message index between potentially multiple handlers
+     * @var int
+     */
+    protected static $messageIndex = 1;
+
+    protected static $sendHeaders = true;
+
+    /**
+     * Base header creation function used by init headers & record headers
+     *
+     * @param  array  $meta    Wildfire Plugin, Protocol & Structure Indexes
+     * @param  string $message Log message
+     * @return array  Complete header string ready for the client as key and message as value
+     */
+    protected function createHeader(array $meta, $message)
+    {
+        $header = sprintf('%s-%s', self::HEADER_PREFIX, join('-', $meta));
+
+        return array($header => $message);
+    }
+
+    /**
+     * Creates message header from record
+     *
+     * @see createHeader()
+     * @param  array  $record
+     * @return string
+     */
+    protected function createRecordHeader(array $record)
+    {
+        // Wildfire is extensible to support multiple protocols & plugins in a single request,
+        // but we're not taking advantage of that (yet), so we're using "1" for simplicity's sake.
+        return $this->createHeader(
+            array(1, 1, 1, self::$messageIndex++),
+            $record['formatted']
+        );
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new WildfireFormatter();
+    }
+
+    /**
+     * Wildfire initialization headers to enable message parsing
+     *
+     * @see createHeader()
+     * @see sendHeader()
+     * @return array
+     */
+    protected function getInitHeaders()
+    {
+        // Initial payload consists of required headers for Wildfire
+        return array_merge(
+            $this->createHeader(array('Protocol', 1), self::PROTOCOL_URI),
+            $this->createHeader(array(1, 'Structure', 1), self::STRUCTURE_URI),
+            $this->createHeader(array(1, 'Plugin', 1), self::PLUGIN_URI)
+        );
+    }
+
+    /**
+     * Send header string to the client
+     *
+     * @param string $header
+     * @param string $content
+     */
+    protected function sendHeader($header, $content)
+    {
+        if (!headers_sent() && self::$sendHeaders) {
+            header(sprintf('%s: %s', $header, $content));
+        }
+    }
+
+    /**
+     * Creates & sends header for a record, ensuring init headers have been sent prior
+     *
+     * @see sendHeader()
+     * @see sendInitHeaders()
+     * @param array $record
+     */
+    protected function write(array $record)
+    {
+        // WildFire-specific headers must be sent prior to any messages
+        if (!self::$initialized) {
+            self::$sendHeaders = $this->headersAccepted();
+
+            foreach ($this->getInitHeaders() as $header => $content) {
+                $this->sendHeader($header, $content);
+            }
+
+            self::$initialized = true;
+        }
+
+        $header = $this->createRecordHeader($record);
+        $this->sendHeader(key($header), current($header));
+    }
+
+    /**
+     * Verifies if the headers are accepted by the current user agent
+     *
+     * @return Boolean
+     */
+    protected function headersAccepted()
+    {
+        return !isset($_SERVER['HTTP_USER_AGENT'])
+               || preg_match('{\bFirePHP/\d+\.\d+\b}', $_SERVER['HTTP_USER_AGENT'])
+               || isset($_SERVER['HTTP_X_FIREPHP_VERSION']);
+    }
+
+    /**
+     * BC getter for the sendHeaders property that has been made static
+     */
+    public function __get($property)
+    {
+        if ('sendHeaders' !== $property) {
+            throw new \InvalidArgumentException('Undefined property '.$property);
+        }
+
+        return static::$sendHeaders;
+    }
+
+    /**
+     * BC setter for the sendHeaders property that has been made static
+     */
+    public function __set($property, $value)
+    {
+        if ('sendHeaders' !== $property) {
+            throw new \InvalidArgumentException('Undefined property '.$property);
+        }
+
+        static::$sendHeaders = $value;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/GelfHandler.php

@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\IMessagePublisher;
+use Monolog\Logger;
+use Monolog\Handler\AbstractProcessingHandler;
+use Monolog\Formatter\GelfMessageFormatter;
+
+/**
+ * Handler to send messages to a Graylog2 (http://www.graylog2.org) server
+ *
+ * @author Matt Lehner <mlehner@gmail.com>
+ */
+class GelfHandler extends AbstractProcessingHandler
+{
+    /**
+     * @var Gelf\IMessagePublisher the publisher object that sends the message to the server
+     */
+    protected $publisher;
+
+    /**
+     * @param Gelf\IMessagePublisher $publisher a publisher object
+     * @param integer                $level     The minimum logging level at which this handler will be triggered
+     * @param Boolean                $bubble    Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(IMessagePublisher $publisher, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        $this->publisher = $publisher;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        $this->publisher = null;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->publisher->publish($record['formatted']);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new GelfMessageFormatter();
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/GroupHandler.php

@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Forwards records to multiple handlers
+ *
+ * @author Lenar Lõhmus <lenar@city.ee>
+ */
+class GroupHandler extends AbstractHandler
+{
+    protected $handlers;
+
+    /**
+     * @param array   $handlers Array of Handlers.
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(array $handlers, $bubble = true)
+    {
+        foreach ($handlers as $handler) {
+            if (!$handler instanceof HandlerInterface) {
+                throw new \InvalidArgumentException('The first argument of the GroupHandler must be an array of HandlerInterface instances.');
+            }
+        }
+
+        $this->handlers = $handlers;
+        $this->bubble = $bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function isHandling(array $record)
+    {
+        foreach ($this->handlers as $handler) {
+            if ($handler->isHandling($record)) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($this->processors) {
+            foreach ($this->processors as $processor) {
+                $record = call_user_func($processor, $record);
+            }
+        }
+
+        foreach ($this->handlers as $handler) {
+            $handler->handle($record);
+        }
+
+        return false === $this->bubble;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        foreach ($this->handlers as $handler) {
+            $handler->handleBatch($records);
+        }
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/HandlerInterface.php

@@ -0,0 +1,90 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FormatterInterface;
+
+/**
+ * Interface that all Monolog Handlers must implement
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+interface HandlerInterface
+{
+    /**
+     * Checks whether the given record will be handled by this handler.
+     *
+     * This is mostly done for performance reasons, to avoid calling processors for nothing.
+     *
+     * Handlers should still check the record levels within handle(), returning false in isHandling()
+     * is no guarantee that handle() will not be called, and isHandling() might not be called
+     * for a given record.
+     *
+     * @param array $record
+     *
+     * @return Boolean
+     */
+    public function isHandling(array $record);
+
+    /**
+     * Handles a record.
+     *
+     * All records may be passed to this method, and the handler should discard
+     * those that it does not want to handle.
+     *
+     * The return value of this function controls the bubbling process of the handler stack.
+     * Unless the bubbling is interrupted (by returning true), the Logger class will keep on
+     * calling further handlers in the stack with a given log record.
+     *
+     * @param  array   $record The record to handle
+     * @return Boolean true means that this handler handled the record, and that bubbling is not permitted.
+     *                 false means the record was either not processed or that this handler allows bubbling.
+     */
+    public function handle(array $record);
+
+    /**
+     * Handles a set of records at once.
+     *
+     * @param array $records The records to handle (an array of record arrays)
+     */
+    public function handleBatch(array $records);
+
+    /**
+     * Adds a processor in the stack.
+     *
+     * @param  callable $callback
+     * @return self
+     */
+    public function pushProcessor($callback);
+
+    /**
+     * Removes the processor on top of the stack and returns it.
+     *
+     * @return callable
+     */
+    public function popProcessor();
+
+    /**
+     * Sets the formatter.
+     *
+     * @param  FormatterInterface $formatter
+     * @return self
+     */
+    public function setFormatter(FormatterInterface $formatter);
+
+    /**
+     * Gets the formatter.
+     *
+     * @return FormatterInterface
+     */
+    public function getFormatter();
+}

vendor/monolog/monolog/src/Monolog/Handler/HipChatHandler.php

@@ -0,0 +1,153 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the hipchat api to a hipchat room
+ *
+ * Notes:
+ * API token - HipChat API token
+ * Room      - HipChat Room Id or name, where messages are sent
+ * Name      - Name used to send the message (from)
+ * notify    - Should the message trigger a notification in the clients
+ *
+ * @author Rafael Dohms <rafael@doh.ms>
+ * @see    https://www.hipchat.com/docs/api
+ */
+class HipChatHandler extends SocketHandler
+{
+    /**
+     * @var string
+     */
+    private $token;
+
+    /**
+     * @var array
+     */
+    private $room;
+
+    /**
+     * @var string
+     */
+    private $name;
+
+    /**
+     * @var boolean
+     */
+    private $notify;
+
+    /**
+     * @param string  $token  HipChat API Token
+     * @param string  $room   The room that should be alerted of the message (Id or Name)
+     * @param string  $name   Name used in the "from" field
+     * @param bool    $notify Trigger a notification in clients or not
+     * @param int     $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean $useSSL Whether to connect via SSL.
+     */
+    public function __construct($token, $room, $name = 'Monolog', $notify = false, $level = Logger::CRITICAL, $bubble = true, $useSSL = true)
+    {
+        $connectionString = $useSSL ? 'ssl://api.hipchat.com:443' : 'api.hipchat.com:80';
+        parent::__construct($connectionString, $level, $bubble);
+
+        $this->token = $token;
+        $this->name = $name;
+        $this->notify = $notify;
+        $this->room = $room;
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param  array  $record
+     * @return string
+     */
+    protected function generateDataStream($record)
+    {
+        $content = $this->buildContent($record);
+
+        return $this->buildHeader($content) . $content;
+    }
+
+    /**
+     * Builds the body of API call
+     *
+     * @param  array  $record
+     * @return string
+     */
+    private function buildContent($record)
+    {
+        $dataArray = array(
+            'from' => $this->name,
+            'room_id' => $this->room,
+            'notify' => $this->notify,
+            'message' => $record['formatted'],
+            'message_format' => 'text',
+            'color' => $this->getAlertColor($record['level']),
+        );
+
+        return http_build_query($dataArray);
+    }
+
+    /**
+     * Builds the header of the API Call
+     *
+     * @param  string $content
+     * @return string
+     */
+    private function buildHeader($content)
+    {
+        $header = "POST /v1/rooms/message?format=json&auth_token=".$this->token." HTTP/1.1\r\n";
+        $header .= "Host: api.hipchat.com\r\n";
+        $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+        $header .= "Content-Length: " . strlen($content) . "\r\n";
+        $header .= "\r\n";
+
+        return $header;
+    }
+
+    /**
+     * Assigns a color to each level of log records.
+     *
+     * @param  integer $level
+     * @return string
+     */
+    protected function getAlertColor($level)
+    {
+        switch (true) {
+            case $level >= Logger::ERROR:
+                return 'red';
+            case $level >= Logger::WARNING:
+                return 'yellow';
+            case $level >= Logger::INFO:
+                return 'green';
+            case $level == Logger::DEBUG:
+                return 'gray';
+            default:
+                return 'yellow';
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     *
+     * @param array $record
+     */
+    public function write(array $record)
+    {
+        parent::write($record);
+        $this->closeSocket();
+    }
+
+}

vendor/monolog/monolog/src/Monolog/Handler/MailHandler.php

@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Base class for all mail handlers
+ *
+ * @author Gyula Sallai
+ */
+abstract class MailHandler extends AbstractProcessingHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $messages = array();
+
+        foreach ($records as $record) {
+            if ($record['level'] < $this->level) {
+                continue;
+            }
+            $messages[] = $this->processRecord($record);
+        }
+
+        if (!empty($messages)) {
+            $this->send((string) $this->getFormatter()->formatBatch($messages), $messages);
+        }
+    }
+
+    /**
+     * Send a mail with the given content
+     *
+     * @param string $content
+     * @param array  $records the array of log records that formed this content
+     */
+    abstract protected function send($content, array $records);
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->send((string) $record['formatted'], array($record));
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/MissingExtensionException.php

@@ -0,0 +1,22 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+/**
+ * Exception can be thrown if an extension for an handler is missing
+ *
+ * @author  Christian Bergau <cbergau86@gmail.com>
+ */
+class MissingExtensionException extends \Exception
+{
+
+}

vendor/monolog/monolog/src/Monolog/Handler/MongoDBHandler.php

@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Thomas Tourlourat <thomas@tourlourat.com>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\NormalizerFormatter;
+
+/**
+ * Logs to a MongoDB database.
+ *
+ * usage example:
+ *
+ *   $log = new Logger('application');
+ *   $mongodb = new MongoDBHandler(new \Mongo("mongodb://localhost:27017"), "logs", "prod");
+ *   $log->pushHandler($mongodb);
+ *
+ * @author Thomas Tourlourat <thomas@tourlourat.com>
+ */
+class MongoDBHandler extends AbstractProcessingHandler
+{
+    private $mongoCollection;
+
+    public function __construct($mongo, $database, $collection, $level = Logger::DEBUG, $bubble = true)
+    {
+        if (!($mongo instanceof \MongoClient || $mongo instanceof \Mongo)) {
+            throw new \InvalidArgumentException('MongoClient or Mongo instance required');
+        }
+
+        $this->mongoCollection = $mongo->selectCollection($database, $collection);
+
+        parent::__construct($level, $bubble);
+    }
+
+    protected function write(array $record)
+    {
+        $this->mongoCollection->save($record["formatted"]);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new NormalizerFormatter();
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/NativeMailerHandler.php

@@ -0,0 +1,71 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * NativeMailerHandler uses the mail() function to send the emails
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ */
+class NativeMailerHandler extends MailHandler
+{
+    protected $to;
+    protected $subject;
+    protected $headers = array(
+        'Content-type: text/plain; charset=utf-8'
+    );
+    protected $maxColumnWidth;
+
+    /**
+     * @param string|array $to             The receiver of the mail
+     * @param string       $subject        The subject of the mail
+     * @param string       $from           The sender of the mail
+     * @param integer      $level          The minimum logging level at which this handler will be triggered
+     * @param boolean      $bubble         Whether the messages that are handled can bubble up the stack or not
+     * @param int          $maxColumnWidth The maximum column width that the message lines will have
+     */
+    public function __construct($to, $subject, $from, $level = Logger::ERROR, $bubble = true, $maxColumnWidth = 70)
+    {
+        parent::__construct($level, $bubble);
+        $this->to = is_array($to) ? $to : array($to);
+        $this->subject = $subject;
+        $this->addHeader(sprintf('From: %s', $from));
+        $this->maxColumnWidth = $maxColumnWidth;
+    }
+
+    /**
+     * @param string|array $headers Custom added headers
+     */
+    public function addHeader($headers)
+    {
+        foreach ((array) $headers as $header) {
+            if (strpos($header, "\n") !== false || strpos($header, "\r") !== false) {
+                throw new \InvalidArgumentException('Headers can not contain newline characters for security reasons');
+            }
+            $this->headers[] = $header;
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function send($content, array $records)
+    {
+        $content = wordwrap($content, $this->maxColumnWidth);
+        $headers = implode("\r\n", $this->headers) . "\r\n";
+        foreach ($this->to as $to) {
+            mail($to, $this->subject, $content, $headers);
+        }
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/NewRelicHandler.php

@@ -0,0 +1,102 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Class to record a log on a NewRelic application
+ *
+ * @see https://newrelic.com/docs/php/new-relic-for-php
+ */
+class NewRelicHandler extends AbstractProcessingHandler
+{
+    /**
+     * Name of the New Relic application that will receive logs from this handler.
+     *
+     * @var string
+     */
+    protected $appName;
+
+    /**
+     * {@inheritDoc}
+     *
+     * @param string $appName
+     */
+    public function __construct($level = Logger::ERROR, $bubble = true, $appName = null)
+    {
+        parent::__construct($level, $bubble);
+
+        $this->appName = $appName;
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function write(array $record)
+    {
+        if (!$this->isNewRelicEnabled()) {
+            throw new MissingExtensionException('The newrelic PHP extension is required to use the NewRelicHandler');
+        }
+
+        if ($appName = $this->getAppName($record['context'])) {
+            $this->setNewRelicAppName($appName);
+        }
+
+        if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) {
+            newrelic_notice_error($record['message'], $record['context']['exception']);
+            unset($record['context']['exception']);
+        } else {
+            newrelic_notice_error($record['message']);
+        }
+
+        foreach ($record['context'] as $key => $parameter) {
+            newrelic_add_custom_parameter($key, $parameter);
+        }
+    }
+
+    /**
+     * Checks whether the NewRelic extension is enabled in the system.
+     *
+     * @return bool
+     */
+    protected function isNewRelicEnabled()
+    {
+        return extension_loaded('newrelic');
+    }
+
+    /**
+     * Returns the appname where this log should be sent. Each log can override the default appname, set in this
+     * handler's constructor, by providing the appname in its context.
+     *
+     * @param array $context
+     * @return null|string
+     */
+    protected function getAppName(array $context)
+    {
+        if (isset($context['appname'])) {
+            return $context['appname'];
+        }
+
+        return $this->appName;
+    }
+
+    /**
+     * Sets the NewRelic application that should receive this log.
+     *
+     * @param string $appName
+     */
+    protected function setNewRelicAppName($appName)
+    {
+        newrelic_set_appname($appName);
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/NullHandler.php

@@ -0,0 +1,45 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Blackhole
+ *
+ * Any record it can handle will be thrown away. This can be used
+ * to put on top of an existing stack to override it temporarily.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class NullHandler extends AbstractHandler
+{
+    /**
+     * @param integer $level The minimum logging level at which this handler will be triggered
+     */
+    public function __construct($level = Logger::DEBUG)
+    {
+        parent::__construct($level, false);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        if ($record['level'] < $this->level) {
+            return false;
+        }
+
+        return true;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/PushoverHandler.php

@@ -0,0 +1,128 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Sends notifications through the pushover api to mobile phones
+ *
+ * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com>
+ * @see    https://www.pushover.net/api
+ */
+class PushoverHandler extends SocketHandler
+{
+    private $token;
+    private $users;
+    private $title;
+    private $user;
+    private $retry;
+    private $expire;
+
+    private $highPriorityLevel;
+    private $emergencyLevel;
+
+    /**
+     * @param string       $token  Pushover api token
+     * @param string|array $users  Pushover user id or array of ids the message will be sent to
+     * @param string       $title  Title sent to the Pushover API
+     * @param integer      $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean      $bubble Whether the messages that are handled can bubble up the stack or not
+     * @param Boolean      $useSSL Whether to connect via SSL. Required when pushing messages to users that are not
+     *                        the pushover.net app owner. OpenSSL is required for this option.
+     * @param integer $highPriorityLevel The minimum logging level at which this handler will start
+     *                                   sending "high priority" requests to the Pushover API
+     * @param integer $emergencyLevel The minimum logging level at which this handler will start
+     *                                sending "emergency" requests to the Pushover API
+     * @param integer $retry  The retry parameter specifies how often (in seconds) the Pushover servers will send the same notification to the user.
+     * @param integer $expire The expire parameter specifies how many seconds your notification will continue to be retried for (every retry seconds).
+     */
+    public function __construct($token, $users, $title = null, $level = Logger::CRITICAL, $bubble = true, $useSSL = true, $highPriorityLevel = Logger::CRITICAL, $emergencyLevel = Logger::EMERGENCY, $retry = 30, $expire = 25200)
+    {
+        $connectionString = $useSSL ? 'ssl://api.pushover.net:443' : 'api.pushover.net:80';
+        parent::__construct($connectionString, $level, $bubble);
+
+        $this->token = $token;
+        $this->users = (array) $users;
+        $this->title = $title ?: gethostname();
+        $this->highPriorityLevel = $highPriorityLevel;
+        $this->emergencyLevel = $emergencyLevel;
+        $this->retry = $retry;
+        $this->expire = $expire;
+    }
+
+    protected function generateDataStream($record)
+    {
+        $content = $this->buildContent($record);
+
+        return $this->buildHeader($content) . $content;
+    }
+
+    private function buildContent($record)
+    {
+        // Pushover has a limit of 512 characters on title and message combined.
+        $maxMessageLength = 512 - strlen($this->title);
+        $message = substr($record['message'], 0, $maxMessageLength);
+        $timestamp = $record['datetime']->getTimestamp();
+
+        $dataArray = array(
+            'token' => $this->token,
+            'user' => $this->user,
+            'message' => $message,
+            'title' => $this->title,
+            'timestamp' => $timestamp
+        );
+
+        if ($record['level'] >= $this->emergencyLevel) {
+            $dataArray['priority'] = 2;
+            $dataArray['retry'] = $this->retry;
+            $dataArray['expire'] = $this->expire;
+        } elseif ($record['level'] >= $this->highPriorityLevel) {
+            $dataArray['priority'] = 1;
+        }
+
+        return http_build_query($dataArray);
+    }
+
+    private function buildHeader($content)
+    {
+        $header = "POST /1/messages.json HTTP/1.1\r\n";
+        $header .= "Host: api.pushover.net\r\n";
+        $header .= "Content-Type: application/x-www-form-urlencoded\r\n";
+        $header .= "Content-Length: " . strlen($content) . "\r\n";
+        $header .= "\r\n";
+
+        return $header;
+    }
+
+    public function write(array $record)
+    {
+        foreach ($this->users as $user) {
+            $this->user = $user;
+
+            parent::write($record);
+            $this->closeSocket();
+        }
+
+        $this->user = null;
+    }
+
+    public function setHighPriorityLevel($value)
+    {
+        $this->highPriorityLevel = $value;
+    }
+
+    public function setEmergencyLevel($value)
+    {
+        $this->emergencyLevel = $value;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/RavenHandler.php

@@ -0,0 +1,167 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Formatter\FormatterInterface;
+use Monolog\Logger;
+use Monolog\Handler\AbstractProcessingHandler;
+use Raven_Client;
+
+/**
+ * Handler to send messages to a Sentry (https://github.com/dcramer/sentry) server
+ * using raven-php (https://github.com/getsentry/raven-php)
+ *
+ * @author Marc Abramowitz <marc@marc-abramowitz.com>
+ */
+class RavenHandler extends AbstractProcessingHandler
+{
+    /**
+     * Translates Monolog log levels to Raven log levels.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => Raven_Client::DEBUG,
+        Logger::INFO      => Raven_Client::INFO,
+        Logger::NOTICE    => Raven_Client::INFO,
+        Logger::WARNING   => Raven_Client::WARNING,
+        Logger::ERROR     => Raven_Client::ERROR,
+        Logger::CRITICAL  => Raven_Client::FATAL,
+        Logger::ALERT     => Raven_Client::FATAL,
+        Logger::EMERGENCY => Raven_Client::FATAL,
+    );
+
+    /**
+     * @var Raven_Client the client object that sends the message to the server
+     */
+    protected $ravenClient;
+
+    /**
+     * @var LineFormatter The formatter to use for the logs generated via handleBatch()
+     */
+    protected $batchFormatter;
+
+    /**
+     * @param Raven_Client $ravenClient
+     * @param integer      $level       The minimum logging level at which this handler will be triggered
+     * @param Boolean      $bubble      Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(Raven_Client $ravenClient, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+
+        $this->ravenClient = $ravenClient;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function handleBatch(array $records)
+    {
+        $level = $this->level;
+
+        // filter records based on their level
+        $records = array_filter($records, function($record) use ($level) {
+            return $record['level'] >= $level;
+        });
+
+        if (!$records) {
+            return;
+        }
+
+        // the record with the highest severity is the "main" one
+        $record = array_reduce($records, function($highest, $record) {
+            if ($record['level'] >= $highest['level']) {
+                $highest = $record;
+
+                return $highest;
+            }
+        });
+
+        // the other ones are added as a context item
+        $logs = array();
+        foreach ($records as $r) {
+            $logs[] = $this->processRecord($r);
+        }
+
+        if ($logs) {
+            $record['context']['logs'] = (string) $this->getBatchFormatter()->formatBatch($logs);
+        }
+
+        $this->handle($record);
+    }
+
+    /**
+     * Sets the formatter for the logs generated by handleBatch().
+     *
+     * @param FormatterInterface $formatter
+     */
+    public function setBatchFormatter(FormatterInterface $formatter)
+    {
+        $this->batchFormatter = $formatter;
+    }
+
+    /**
+     * Gets the formatter for the logs generated by handleBatch().
+     *
+     * @return FormatterInterface
+     */
+    public function getBatchFormatter()
+    {
+        if (!$this->batchFormatter) {
+            $this->batchFormatter = $this->getDefaultBatchFormatter();
+        }
+
+        return $this->batchFormatter;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $options = array();
+        $options['level'] = $this->logLevels[$record['level']];
+        if (!empty($record['context'])) {
+            $options['extra']['context'] = $record['context'];
+        }
+        if (!empty($record['extra'])) {
+            $options['extra']['extra'] = $record['extra'];
+        }
+
+        if (isset($record['context']['exception']) && $record['context']['exception'] instanceof \Exception) {
+            $options['extra']['message'] = $record['formatted'];
+            $this->ravenClient->captureException($record['context']['exception'], $options);
+
+            return;
+        }
+
+        $this->ravenClient->captureMessage($record['formatted'], array(), $options);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter('[%channel%] %message%');
+    }
+
+    /**
+     * Gets the default formatter for the logs generated by handleBatch().
+     *
+     * @return FormatterInterface
+     */
+    protected function getDefaultBatchFormatter()
+    {
+        return new LineFormatter();
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/RedisHandler.php

@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Thomas Tourlourat <thomas@tourlourat.com>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Logs to a Redis key using rpush
+ *
+ * usage example:
+ *
+ *   $log = new Logger('application');
+ *   $redis = new RedisHandler(new Predis\Client("tcp://localhost:6379"), "logs", "prod");
+ *   $log->pushHandler($redis);
+ *
+ * @author Thomas Tourlourat <thomas@tourlourat.com>
+ */
+class RedisHandler extends AbstractProcessingHandler
+{
+    private $redisClient;
+    private $redisKey;
+
+    # redis instance, key to use
+    public function __construct($redis, $key, $level = Logger::DEBUG, $bubble = true)
+    {
+        if (!(($redis instanceof \Predis\Client) || ($redis instanceof \Redis))) {
+            throw new \InvalidArgumentException('Predis\Client or Redis instance required');
+        }
+
+        $this->redisClient = $redis;
+        $this->redisKey = $key;
+
+        parent::__construct($level, $bubble);
+    }
+
+    protected function write(array $record)
+    {
+        $this->redisClient->rpush($this->redisKey, $record["formatted"]);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter();
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/RotatingFileHandler.php

@@ -0,0 +1,124 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores logs to files that are rotated every day and a limited number of files are kept.
+ *
+ * This rotation is only intended to be used as a workaround. Using logrotate to
+ * handle the rotation is strongly encouraged when you can use it.
+ *
+ * @author Christophe Coevoet <stof@notk.org>
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class RotatingFileHandler extends StreamHandler
+{
+    protected $filename;
+    protected $maxFiles;
+    protected $mustRotate;
+    protected $nextRotation;
+
+    /**
+     * @param string  $filename
+     * @param integer $maxFiles The maximal amount of files to keep (0 means unlimited)
+     * @param integer $level    The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($filename, $maxFiles = 0, $level = Logger::DEBUG, $bubble = true)
+    {
+        $this->filename = $filename;
+        $this->maxFiles = (int) $maxFiles;
+        $this->nextRotation = new \DateTime('tomorrow');
+
+        parent::__construct($this->getTimedFilename(), $level, $bubble);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        parent::close();
+
+        if (true === $this->mustRotate) {
+            $this->rotate();
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        // on the first record written, if the log is new, we should rotate (once per day)
+        if (null === $this->mustRotate) {
+            $this->mustRotate = !file_exists($this->url);
+        }
+
+        if ($this->nextRotation < $record['datetime']) {
+            $this->mustRotate = true;
+            $this->close();
+        }
+
+        parent::write($record);
+    }
+
+    /**
+     * Rotates the files.
+     */
+    protected function rotate()
+    {
+        // update filename
+        $this->url = $this->getTimedFilename();
+        $this->nextRotation = new \DateTime('tomorrow');
+
+        // skip GC of old logs if files are unlimited
+        if (0 === $this->maxFiles) {
+            return;
+        }
+
+        $fileInfo = pathinfo($this->filename);
+        $glob = $fileInfo['dirname'].'/'.$fileInfo['filename'].'-*';
+        if (!empty($fileInfo['extension'])) {
+            $glob .= '.'.$fileInfo['extension'];
+        }
+        $logFiles = glob($glob);
+        if ($this->maxFiles >= count($logFiles)) {
+            // no files to remove
+            return;
+        }
+
+        // Sorting the files by name to remove the older ones
+        usort($logFiles, function($a, $b) {
+            return strcmp($b, $a);
+        });
+
+        foreach (array_slice($logFiles, $this->maxFiles) as $file) {
+            if (is_writable($file)) {
+                unlink($file);
+            }
+        }
+    }
+
+    protected function getTimedFilename()
+    {
+        $fileInfo = pathinfo($this->filename);
+        $timedFilename = $fileInfo['dirname'].'/'.$fileInfo['filename'].'-'.date('Y-m-d');
+        if (!empty($fileInfo['extension'])) {
+            $timedFilename .= '.'.$fileInfo['extension'];
+        }
+
+        return $timedFilename;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/SocketHandler.php

@@ -0,0 +1,285 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any socket - uses fsockopen() or pfsockopen().
+ *
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ * @see    http://php.net/manual/en/function.fsockopen.php
+ */
+class SocketHandler extends AbstractProcessingHandler
+{
+    private $connectionString;
+    private $connectionTimeout;
+    private $resource;
+    private $timeout = 0;
+    private $persistent = false;
+    private $errno;
+    private $errstr;
+
+    /**
+     * @param string  $connectionString Socket connection string
+     * @param integer $level            The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble           Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($connectionString, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->connectionString = $connectionString;
+        $this->connectionTimeout = (float) ini_get('default_socket_timeout');
+    }
+
+    /**
+     * Connect (if necessary) and write to the socket
+     *
+     * @param array $record
+     *
+     * @throws \UnexpectedValueException
+     * @throws \RuntimeException
+     */
+    public function write(array $record)
+    {
+        $this->connectIfNotConnected();
+        $data = $this->generateDataStream($record);
+        $this->writeToSocket($data);
+    }
+
+    /**
+     * We will not close a PersistentSocket instance so it can be reused in other requests.
+     */
+    public function close()
+    {
+        if (!$this->isPersistent()) {
+            $this->closeSocket();
+        }
+    }
+
+    /**
+     * Close socket, if open
+     */
+    public function closeSocket()
+    {
+        if (is_resource($this->resource)) {
+            fclose($this->resource);
+            $this->resource = null;
+        }
+    }
+
+    /**
+     * Set socket connection to nbe persistent. It only has effect before the connection is initiated.
+     *
+     * @param type $boolean
+     */
+    public function setPersistent($boolean)
+    {
+        $this->persistent = (boolean) $boolean;
+    }
+
+    /**
+     * Set connection timeout.  Only has effect before we connect.
+     *
+     * @param float $seconds
+     *
+     * @see http://php.net/manual/en/function.fsockopen.php
+     */
+    public function setConnectionTimeout($seconds)
+    {
+        $this->validateTimeout($seconds);
+        $this->connectionTimeout = (float) $seconds;
+    }
+
+    /**
+     * Set write timeout. Only has effect before we connect.
+     *
+     * @param float $seconds
+     *
+     * @see http://php.net/manual/en/function.stream-set-timeout.php
+     */
+    public function setTimeout($seconds)
+    {
+        $this->validateTimeout($seconds);
+        $this->timeout = (float) $seconds;
+    }
+
+    /**
+     * Get current connection string
+     *
+     * @return string
+     */
+    public function getConnectionString()
+    {
+        return $this->connectionString;
+    }
+
+    /**
+     * Get persistent setting
+     *
+     * @return boolean
+     */
+    public function isPersistent()
+    {
+        return $this->persistent;
+    }
+
+    /**
+     * Get current connection timeout setting
+     *
+     * @return float
+     */
+    public function getConnectionTimeout()
+    {
+        return $this->connectionTimeout;
+    }
+
+    /**
+     * Get current in-transfer timeout
+     *
+     * @return float
+     */
+    public function getTimeout()
+    {
+        return $this->timeout;
+    }
+
+    /**
+     * Check to see if the socket is currently available.
+     *
+     * UDP might appear to be connected but might fail when writing.  See http://php.net/fsockopen for details.
+     *
+     * @return boolean
+     */
+    public function isConnected()
+    {
+        return is_resource($this->resource)
+            && !feof($this->resource);  // on TCP - other party can close connection.
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function pfsockopen()
+    {
+        return @pfsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function fsockopen()
+    {
+        return @fsockopen($this->connectionString, -1, $this->errno, $this->errstr, $this->connectionTimeout);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     *
+     * @see http://php.net/manual/en/function.stream-set-timeout.php
+     */
+    protected function streamSetTimeout()
+    {
+        $seconds = floor($this->timeout);
+        $microseconds = round(($this->timeout - $seconds)*1e6);
+
+        return stream_set_timeout($this->resource, $seconds, $microseconds);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function fwrite($data)
+    {
+        return @fwrite($this->resource, $data);
+    }
+
+    /**
+     * Wrapper to allow mocking
+     */
+    protected function streamGetMetadata()
+    {
+        return stream_get_meta_data($this->resource);
+    }
+
+    private function validateTimeout($value)
+    {
+        $ok = filter_var($value, FILTER_VALIDATE_FLOAT);
+        if ($ok === false || $value < 0) {
+            throw new \InvalidArgumentException("Timeout must be 0 or a positive float (got $value)");
+        }
+    }
+
+    private function connectIfNotConnected()
+    {
+        if ($this->isConnected()) {
+            return;
+        }
+        $this->connect();
+    }
+
+    protected function generateDataStream($record)
+    {
+        return (string) $record['formatted'];
+    }
+
+    private function connect()
+    {
+        $this->createSocketResource();
+        $this->setSocketTimeout();
+    }
+
+    private function createSocketResource()
+    {
+        if ($this->isPersistent()) {
+            $resource = $this->pfsockopen();
+        } else {
+            $resource = $this->fsockopen();
+        }
+        if (!$resource) {
+            throw new \UnexpectedValueException("Failed connecting to $this->connectionString ($this->errno: $this->errstr)");
+        }
+        $this->resource = $resource;
+    }
+
+    private function setSocketTimeout()
+    {
+        if (!$this->streamSetTimeout()) {
+            throw new \UnexpectedValueException("Failed setting timeout with stream_set_timeout()");
+        }
+    }
+
+    private function writeToSocket($data)
+    {
+        $length = strlen($data);
+        $sent = 0;
+        while ($this->isConnected() && $sent < $length) {
+            if (0 == $sent) {
+                $chunk = $this->fwrite($data);
+            } else {
+                $chunk = $this->fwrite(substr($data, $sent));
+            }
+            if ($chunk === false) {
+                throw new \RuntimeException("Could not write to socket");
+            }
+            $sent += $chunk;
+            $socketInfo = $this->streamGetMetadata();
+            if ($socketInfo['timed_out']) {
+                throw new \RuntimeException("Write timed-out");
+            }
+        }
+        if (!$this->isConnected() && $sent < $length) {
+            throw new \RuntimeException("End-of-file reached, probably we got disconnected (sent $sent of $length)");
+        }
+    }
+
+}

vendor/monolog/monolog/src/Monolog/Handler/StreamHandler.php

@@ -0,0 +1,76 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Stores to any stream resource
+ *
+ * Can be used to store into php://stderr, remote and local files, etc.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class StreamHandler extends AbstractProcessingHandler
+{
+    protected $stream;
+    protected $url;
+
+    /**
+     * @param string  $stream
+     * @param integer $level  The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct($stream, $level = Logger::DEBUG, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        if (is_resource($stream)) {
+            $this->stream = $stream;
+        } else {
+            $this->url = $stream;
+        }
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        if (is_resource($this->stream)) {
+            fclose($this->stream);
+        }
+        $this->stream = null;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        if (null === $this->stream) {
+            if (!$this->url) {
+                throw new \LogicException('Missing stream url, the stream can not be opened. This may be caused by a premature call to close().');
+            }
+            $errorMessage = null;
+            set_error_handler(function ($code, $msg) use (&$errorMessage) {
+                $errorMessage = preg_replace('{^fopen\(.*?\): }', '', $msg);
+            });
+            $this->stream = fopen($this->url, 'a');
+            restore_error_handler();
+            if (!is_resource($this->stream)) {
+                $this->stream = null;
+                throw new \UnexpectedValueException(sprintf('The stream or file "%s" could not be opened: '.$errorMessage, $this->url));
+            }
+        }
+        fwrite($this->stream, (string) $record['formatted']);
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/SwiftMailerHandler.php

@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * SwiftMailerHandler uses Swift_Mailer to send the emails
+ *
+ * @author Gyula Sallai
+ */
+class SwiftMailerHandler extends MailHandler
+{
+    protected $mailer;
+    protected $message;
+
+    /**
+     * @param \Swift_Mailer           $mailer  The mailer to use
+     * @param callable|\Swift_Message $message An example message for real messages, only the body will be replaced
+     * @param integer                 $level   The minimum logging level at which this handler will be triggered
+     * @param Boolean                 $bubble  Whether the messages that are handled can bubble up the stack or not
+     */
+    public function __construct(\Swift_Mailer $mailer, $message, $level = Logger::ERROR, $bubble = true)
+    {
+        parent::__construct($level, $bubble);
+        $this->mailer  = $mailer;
+        if (!$message instanceof \Swift_Message && is_callable($message)) {
+            $message = call_user_func($message);
+        }
+        if (!$message instanceof \Swift_Message) {
+            throw new \InvalidArgumentException('You must provide either a Swift_Message instance or a callable returning it');
+        }
+        $this->message = $message;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function send($content, array $records)
+    {
+        $message = clone $this->message;
+        $message->setBody($content);
+
+        $this->mailer->send($message);
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/SyslogHandler.php

@@ -0,0 +1,127 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+/**
+ * Logs to syslog service.
+ *
+ * usage example:
+ *
+ *   $log = new Logger('application');
+ *   $syslog = new SyslogHandler('myfacility', 'local6');
+ *   $formatter = new LineFormatter("%channel%.%level_name%: %message% %extra%");
+ *   $syslog->setFormatter($formatter);
+ *   $log->pushHandler($syslog);
+ *
+ * @author Sven Paulus <sven@karlsruhe.org>
+ */
+class SyslogHandler extends AbstractProcessingHandler
+{
+    protected $ident;
+    protected $logopts;
+    protected $facility;
+
+    /**
+     * Translates Monolog log levels to syslog log priorities.
+     */
+    private $logLevels = array(
+        Logger::DEBUG     => LOG_DEBUG,
+        Logger::INFO      => LOG_INFO,
+        Logger::NOTICE    => LOG_NOTICE,
+        Logger::WARNING   => LOG_WARNING,
+        Logger::ERROR     => LOG_ERR,
+        Logger::CRITICAL  => LOG_CRIT,
+        Logger::ALERT     => LOG_ALERT,
+        Logger::EMERGENCY => LOG_EMERG,
+    );
+
+    /**
+     * List of valid log facility names.
+     */
+    private $facilities = array(
+        'auth'     => LOG_AUTH,
+        'authpriv' => LOG_AUTHPRIV,
+        'cron'     => LOG_CRON,
+        'daemon'   => LOG_DAEMON,
+        'kern'     => LOG_KERN,
+        'lpr'      => LOG_LPR,
+        'mail'     => LOG_MAIL,
+        'news'     => LOG_NEWS,
+        'syslog'   => LOG_SYSLOG,
+        'user'     => LOG_USER,
+        'uucp'     => LOG_UUCP,
+    );
+
+    /**
+     * @param string  $ident
+     * @param mixed   $facility
+     * @param integer $level    The minimum logging level at which this handler will be triggered
+     * @param Boolean $bubble   Whether the messages that are handled can bubble up the stack or not
+     * @param int     $logopts  Option flags for the openlog() call, defaults to LOG_PID
+     */
+    public function __construct($ident, $facility = LOG_USER, $level = Logger::DEBUG, $bubble = true, $logopts = LOG_PID)
+    {
+        parent::__construct($level, $bubble);
+
+        if (!defined('PHP_WINDOWS_VERSION_BUILD')) {
+            $this->facilities['local0'] = LOG_LOCAL0;
+            $this->facilities['local1'] = LOG_LOCAL1;
+            $this->facilities['local2'] = LOG_LOCAL2;
+            $this->facilities['local3'] = LOG_LOCAL3;
+            $this->facilities['local4'] = LOG_LOCAL4;
+            $this->facilities['local5'] = LOG_LOCAL5;
+            $this->facilities['local6'] = LOG_LOCAL6;
+            $this->facilities['local7'] = LOG_LOCAL7;
+        }
+
+        // convert textual description of facility to syslog constant
+        if (array_key_exists(strtolower($facility), $this->facilities)) {
+            $facility = $this->facilities[strtolower($facility)];
+        } elseif (!in_array($facility, array_values($this->facilities), true)) {
+            throw new \UnexpectedValueException('Unknown facility value "'.$facility.'" given');
+        }
+
+        $this->ident = $ident;
+        $this->logopts = $logopts;
+        $this->facility = $facility;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function close()
+    {
+        closelog();
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        if (!openlog($this->ident, $this->logopts, $this->facility)) {
+            throw new \LogicException('Can\'t open syslog for ident "'.$this->ident.'" and facility "'.$this->facility.'"');
+        }
+        syslog($this->logLevels[$record['level']], (string) $record['formatted']);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function getDefaultFormatter()
+    {
+        return new LineFormatter('%channel%.%level_name%: %message% %context% %extra%');
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/TestHandler.php

@@ -0,0 +1,140 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+/**
+ * Used for testing purposes.
+ *
+ * It records all records and gives you access to them for verification.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class TestHandler extends AbstractProcessingHandler
+{
+    protected $records = array();
+    protected $recordsByLevel = array();
+
+    public function getRecords()
+    {
+        return $this->records;
+    }
+
+    public function hasEmergency($record)
+    {
+        return $this->hasRecord($record, Logger::EMERGENCY);
+    }
+
+    public function hasAlert($record)
+    {
+        return $this->hasRecord($record, Logger::ALERT);
+    }
+
+    public function hasCritical($record)
+    {
+        return $this->hasRecord($record, Logger::CRITICAL);
+    }
+
+    public function hasError($record)
+    {
+        return $this->hasRecord($record, Logger::ERROR);
+    }
+
+    public function hasWarning($record)
+    {
+        return $this->hasRecord($record, Logger::WARNING);
+    }
+
+    public function hasNotice($record)
+    {
+        return $this->hasRecord($record, Logger::NOTICE);
+    }
+
+    public function hasInfo($record)
+    {
+        return $this->hasRecord($record, Logger::INFO);
+    }
+
+    public function hasDebug($record)
+    {
+        return $this->hasRecord($record, Logger::DEBUG);
+    }
+
+    public function hasEmergencyRecords()
+    {
+        return isset($this->recordsByLevel[Logger::EMERGENCY]);
+    }
+
+    public function hasAlertRecords()
+    {
+        return isset($this->recordsByLevel[Logger::ALERT]);
+    }
+
+    public function hasCriticalRecords()
+    {
+        return isset($this->recordsByLevel[Logger::CRITICAL]);
+    }
+
+    public function hasErrorRecords()
+    {
+        return isset($this->recordsByLevel[Logger::ERROR]);
+    }
+
+    public function hasWarningRecords()
+    {
+        return isset($this->recordsByLevel[Logger::WARNING]);
+    }
+
+    public function hasNoticeRecords()
+    {
+        return isset($this->recordsByLevel[Logger::NOTICE]);
+    }
+
+    public function hasInfoRecords()
+    {
+        return isset($this->recordsByLevel[Logger::INFO]);
+    }
+
+    public function hasDebugRecords()
+    {
+        return isset($this->recordsByLevel[Logger::DEBUG]);
+    }
+
+    protected function hasRecord($record, $level)
+    {
+        if (!isset($this->recordsByLevel[$level])) {
+            return false;
+        }
+
+        if (is_array($record)) {
+            $record = $record['message'];
+        }
+
+        foreach ($this->recordsByLevel[$level] as $rec) {
+            if ($rec['message'] === $record) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->recordsByLevel[$record['level']][] = $record;
+        $this->records[] = $record;
+    }
+}

vendor/monolog/monolog/src/Monolog/Handler/ZendMonitorHandler.php

@@ -0,0 +1,95 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\NormalizerFormatter;
+use Monolog\Logger;
+
+/**
+ * Handler sending logs to Zend Monitor
+ *
+ * @author  Christian Bergau <cbergau86@gmail.com>
+ */
+class ZendMonitorHandler extends AbstractProcessingHandler
+{
+    /**
+     * Monolog level / ZendMonitor Custom Event priority map
+     *
+     * @var array
+     */
+    protected $levelMap = array(
+        Logger::DEBUG     => 1,
+        Logger::INFO      => 2,
+        Logger::NOTICE    => 3,
+        Logger::WARNING   => 4,
+        Logger::ERROR     => 5,
+        Logger::CRITICAL  => 6,
+        Logger::ALERT     => 7,
+        Logger::EMERGENCY => 0,
+    );
+
+    /**
+     * Construct
+     *
+     * @param  int                       $level
+     * @param  bool                      $bubble
+     * @throws MissingExtensionException
+     */
+    public function __construct($level = Logger::DEBUG, $bubble = true)
+    {
+        if (!function_exists('zend_monitor_custom_event')) {
+            throw new MissingExtensionException('You must have Zend Server installed in order to use this handler');
+        }
+        parent::__construct($level, $bubble);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    protected function write(array $record)
+    {
+        $this->writeZendMonitorCustomEvent(
+            $this->levelMap[$record['level']],
+            $record['message'],
+            $record['formatted']
+        );
+    }
+
+    /**
+     * Write a record to Zend Monitor
+     *
+     * @param int    $level
+     * @param string $message
+     * @param array  $formatted
+     */
+    protected function writeZendMonitorCustomEvent($level, $message, $formatted)
+    {
+        zend_monitor_custom_event($level, $message, $formatted);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function getDefaultFormatter()
+    {
+        return new NormalizerFormatter();
+    }
+
+    /**
+     * Get the level map
+     *
+     * @return array
+     */
+    public function getLevelMap()
+    {
+        return $this->levelMap;
+    }
+}

vendor/monolog/monolog/src/Monolog/Logger.php

@@ -0,0 +1,574 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\HandlerInterface;
+use Monolog\Handler\StreamHandler;
+use Psr\Log\LoggerInterface;
+use Psr\Log\InvalidArgumentException;
+
+/**
+ * Monolog log channel
+ *
+ * It contains a stack of Handlers and a stack of Processors,
+ * and uses them to store records that are added to it.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class Logger implements LoggerInterface
+{
+    /**
+     * Detailed debug information
+     */
+    const DEBUG = 100;
+
+    /**
+     * Interesting events
+     *
+     * Examples: User logs in, SQL logs.
+     */
+    const INFO = 200;
+
+    /**
+     * Uncommon events
+     */
+    const NOTICE = 250;
+
+    /**
+     * Exceptional occurrences that are not errors
+     *
+     * Examples: Use of deprecated APIs, poor use of an API,
+     * undesirable things that are not necessarily wrong.
+     */
+    const WARNING = 300;
+
+    /**
+     * Runtime errors
+     */
+    const ERROR = 400;
+
+    /**
+     * Critical conditions
+     *
+     * Example: Application component unavailable, unexpected exception.
+     */
+    const CRITICAL = 500;
+
+    /**
+     * Action must be taken immediately
+     *
+     * Example: Entire website down, database unavailable, etc.
+     * This should trigger the SMS alerts and wake you up.
+     */
+    const ALERT = 550;
+
+    /**
+     * Urgent alert.
+     */
+    const EMERGENCY = 600;
+
+    /**
+     * Monolog API version
+     *
+     * This is only bumped when API breaks are done and should
+     * follow the major version of the library
+     *
+     * @var int
+     */
+    const API = 1;
+
+    protected static $levels = array(
+        100 => 'DEBUG',
+        200 => 'INFO',
+        250 => 'NOTICE',
+        300 => 'WARNING',
+        400 => 'ERROR',
+        500 => 'CRITICAL',
+        550 => 'ALERT',
+        600 => 'EMERGENCY',
+    );
+
+    /**
+     * @var DateTimeZone
+     */
+    protected static $timezone;
+
+    protected $name;
+
+    /**
+     * The handler stack
+     *
+     * @var array of Monolog\Handler\HandlerInterface
+     */
+    protected $handlers;
+
+    /**
+     * Processors that will process all log records
+     *
+     * To process records of a single handler instead, add the processor on that specific handler
+     *
+     * @var array of callables
+     */
+    protected $processors;
+
+    /**
+     * @param string $name       The logging channel
+     * @param array  $handlers   Optional stack of handlers, the first one in the array is called first, etc.
+     * @param array  $processors Optional array of processors
+     */
+    public function __construct($name, array $handlers = array(), array $processors = array())
+    {
+        $this->name = $name;
+        $this->handlers = $handlers;
+        $this->processors = $processors;
+    }
+
+    /**
+     * @return string
+     */
+    public function getName()
+    {
+        return $this->name;
+    }
+
+    /**
+     * Pushes a handler on to the stack.
+     *
+     * @param HandlerInterface $handler
+     */
+    public function pushHandler(HandlerInterface $handler)
+    {
+        array_unshift($this->handlers, $handler);
+    }
+
+    /**
+     * Pops a handler from the stack
+     *
+     * @return HandlerInterface
+     */
+    public function popHandler()
+    {
+        if (!$this->handlers) {
+            throw new \LogicException('You tried to pop from an empty handler stack.');
+        }
+
+        return array_shift($this->handlers);
+    }
+
+    /**
+     * Adds a processor on to the stack.
+     *
+     * @param callable $callback
+     */
+    public function pushProcessor($callback)
+    {
+        if (!is_callable($callback)) {
+            throw new \InvalidArgumentException('Processors must be valid callables (callback or object with an __invoke method), '.var_export($callback, true).' given');
+        }
+        array_unshift($this->processors, $callback);
+    }
+
+    /**
+     * Removes the processor on top of the stack and returns it.
+     *
+     * @return callable
+     */
+    public function popProcessor()
+    {
+        if (!$this->processors) {
+            throw new \LogicException('You tried to pop from an empty processor stack.');
+        }
+
+        return array_shift($this->processors);
+    }
+
+    /**
+     * Adds a log record.
+     *
+     * @param  integer $level   The logging level
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addRecord($level, $message, array $context = array())
+    {
+        if (!$this->handlers) {
+            $this->pushHandler(new StreamHandler('php://stderr', static::DEBUG));
+        }
+
+        if (!static::$timezone) {
+            static::$timezone = new \DateTimeZone(date_default_timezone_get() ?: 'UTC');
+        }
+
+        $record = array(
+            'message' => (string) $message,
+            'context' => $context,
+            'level' => $level,
+            'level_name' => static::getLevelName($level),
+            'channel' => $this->name,
+            'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true)), static::$timezone)->setTimezone(static::$timezone),
+            'extra' => array(),
+        );
+        // check if any handler will handle this message
+        $handlerKey = null;
+        foreach ($this->handlers as $key => $handler) {
+            if ($handler->isHandling($record)) {
+                $handlerKey = $key;
+                break;
+            }
+        }
+        // none found
+        if (null === $handlerKey) {
+            return false;
+        }
+
+        // found at least one, process message and dispatch it
+        foreach ($this->processors as $processor) {
+            $record = call_user_func($processor, $record);
+        }
+        while (isset($this->handlers[$handlerKey]) &&
+            false === $this->handlers[$handlerKey]->handle($record)) {
+            $handlerKey++;
+        }
+
+        return true;
+    }
+
+    /**
+     * Adds a log record at the DEBUG level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addDebug($message, array $context = array())
+    {
+        return $this->addRecord(static::DEBUG, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the INFO level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addInfo($message, array $context = array())
+    {
+        return $this->addRecord(static::INFO, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the NOTICE level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addNotice($message, array $context = array())
+    {
+        return $this->addRecord(static::NOTICE, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the WARNING level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addWarning($message, array $context = array())
+    {
+        return $this->addRecord(static::WARNING, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ERROR level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addError($message, array $context = array())
+    {
+        return $this->addRecord(static::ERROR, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the CRITICAL level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addCritical($message, array $context = array())
+    {
+        return $this->addRecord(static::CRITICAL, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ALERT level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addAlert($message, array $context = array())
+    {
+        return $this->addRecord(static::ALERT, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the EMERGENCY level.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function addEmergency($message, array $context = array())
+    {
+      return $this->addRecord(static::EMERGENCY, $message, $context);
+    }
+
+    /**
+     * Gets all supported logging levels.
+     *
+     * @return array Assoc array with human-readable level names => level codes.
+     */
+    public static function getLevels()
+    {
+        return array_flip(static::$levels);
+    }
+
+    /**
+     * Gets the name of the logging level.
+     *
+     * @param  integer $level
+     * @return string
+     */
+    public static function getLevelName($level)
+    {
+        if (!isset(static::$levels[$level])) {
+            throw new InvalidArgumentException('Level "'.$level.'" is not defined, use one of: '.implode(', ', array_keys(static::$levels)));
+        }
+
+        return static::$levels[$level];
+    }
+
+    /**
+     * Checks whether the Logger has a handler that listens on the given level
+     *
+     * @param  integer $level
+     * @return Boolean
+     */
+    public function isHandling($level)
+    {
+        $record = array(
+            'level' => $level,
+        );
+
+        foreach ($this->handlers as $handler) {
+            if ($handler->isHandling($record)) {
+                return true;
+            }
+        }
+
+        return false;
+    }
+
+    /**
+     * Adds a log record at an arbitrary level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  mixed   $level   The log level
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function log($level, $message, array $context = array())
+    {
+        if (is_string($level) && defined(__CLASS__.'::'.strtoupper($level))) {
+            $level = constant(__CLASS__.'::'.strtoupper($level));
+        }
+
+        return $this->addRecord($level, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the DEBUG level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function debug($message, array $context = array())
+    {
+        return $this->addRecord(static::DEBUG, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the INFO level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function info($message, array $context = array())
+    {
+        return $this->addRecord(static::INFO, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the INFO level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function notice($message, array $context = array())
+    {
+        return $this->addRecord(static::NOTICE, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the WARNING level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function warn($message, array $context = array())
+    {
+        return $this->addRecord(static::WARNING, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the WARNING level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function warning($message, array $context = array())
+    {
+        return $this->addRecord(static::WARNING, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ERROR level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function err($message, array $context = array())
+    {
+        return $this->addRecord(static::ERROR, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ERROR level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function error($message, array $context = array())
+    {
+        return $this->addRecord(static::ERROR, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the CRITICAL level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function crit($message, array $context = array())
+    {
+        return $this->addRecord(static::CRITICAL, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the CRITICAL level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function critical($message, array $context = array())
+    {
+        return $this->addRecord(static::CRITICAL, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the ALERT level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function alert($message, array $context = array())
+    {
+        return $this->addRecord(static::ALERT, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the EMERGENCY level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function emerg($message, array $context = array())
+    {
+        return $this->addRecord(static::EMERGENCY, $message, $context);
+    }
+
+    /**
+     * Adds a log record at the EMERGENCY level.
+     *
+     * This method allows for compatibility with common interfaces.
+     *
+     * @param  string  $message The log message
+     * @param  array   $context The log context
+     * @return Boolean Whether the record has been processed
+     */
+    public function emergency($message, array $context = array())
+    {
+        return $this->addRecord(static::EMERGENCY, $message, $context);
+    }
+}

vendor/monolog/monolog/src/Monolog/Processor/IntrospectionProcessor.php

@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects line/file:class/function where the log message came from
+ *
+ * Warning: This only works if the handler processes the logs directly.
+ * If you put the processor on a handler that is behind a FingersCrossedHandler
+ * for example, the processor will only be called once the trigger level is reached,
+ * and all the log records will have the same file/line/.. data from the call that
+ * triggered the FingersCrossedHandler.
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class IntrospectionProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        $trace = debug_backtrace();
+
+        // skip first since it's always the current method
+        array_shift($trace);
+        // the call_user_func call is also skipped
+        array_shift($trace);
+
+        $i = 0;
+        while (isset($trace[$i]['class']) && false !== strpos($trace[$i]['class'], 'Monolog\\')) {
+            $i++;
+        }
+
+        // we should have the call source now
+        $record['extra'] = array_merge(
+            $record['extra'],
+            array(
+                'file'      => isset($trace[$i-1]['file']) ? $trace[$i-1]['file'] : null,
+                'line'      => isset($trace[$i-1]['line']) ? $trace[$i-1]['line'] : null,
+                'class'     => isset($trace[$i]['class']) ? $trace[$i]['class'] : null,
+                'function'  => isset($trace[$i]['function']) ? $trace[$i]['function'] : null,
+            )
+        );
+
+        return $record;
+    }
+}

vendor/monolog/monolog/src/Monolog/Processor/MemoryPeakUsageProcessor.php

@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects memory_get_peak_usage in all records
+ *
+ * @see Monolog\Processor\MemoryProcessor::__construct() for options
+ * @author Rob Jensen
+ */
+class MemoryPeakUsageProcessor extends MemoryProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        $bytes = memory_get_peak_usage($this->realUsage);
+        $formatted = self::formatBytes($bytes);
+
+        $record['extra'] = array_merge(
+            $record['extra'],
+            array(
+                'memory_peak_usage' => $formatted,
+            )
+        );
+
+        return $record;
+    }
+}

vendor/monolog/monolog/src/Monolog/Processor/MemoryProcessor.php

@@ -0,0 +1,50 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Some methods that are common for all memory processors
+ *
+ * @author Rob Jensen
+ */
+abstract class MemoryProcessor
+{
+    protected $realUsage;
+
+    /**
+     * @param boolean $realUsage
+     */
+    public function __construct($realUsage = true)
+    {
+        $this->realUsage = (boolean) $realUsage;
+    }
+
+    /**
+     * Formats bytes into a human readable string
+     *
+     * @param  int    $bytes
+     * @return string
+     */
+    protected static function formatBytes($bytes)
+    {
+        $bytes = (int) $bytes;
+
+        if ($bytes > 1024*1024) {
+            return round($bytes/1024/1024, 2).' MB';
+        } elseif ($bytes > 1024) {
+            return round($bytes/1024, 2).' KB';
+        }
+
+        return $bytes . ' B';
+    }
+
+}

vendor/monolog/monolog/src/Monolog/Processor/MemoryUsageProcessor.php

@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects memory_get_usage in all records
+ *
+ * @see Monolog\Processor\MemoryProcessor::__construct() for options
+ * @author Rob Jensen
+ */
+class MemoryUsageProcessor extends MemoryProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        $bytes = memory_get_usage($this->realUsage);
+        $formatted = self::formatBytes($bytes);
+
+        $record['extra'] = array_merge(
+            $record['extra'],
+            array(
+                'memory_usage' => $formatted,
+            )
+        );
+
+        return $record;
+    }
+}

vendor/monolog/monolog/src/Monolog/Processor/ProcessIdProcessor.php

@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds value of getmypid into records
+ *
+ * @author Andreas Hörnicke
+ */
+class ProcessIdProcessor
+{
+    private static $pid;
+
+    public function __construct()
+    {
+        if (null === self::$pid) {
+            self::$pid = getmypid();
+        }
+    }
+
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        $record['extra']['process_id'] = self::$pid;
+
+        return $record;
+    }
+}

vendor/monolog/monolog/src/Monolog/Processor/PsrLogMessageProcessor.php

@@ -0,0 +1,42 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Processes a record's message according to PSR-3 rules
+ *
+ * It replaces {foo} with the value from $context['foo']
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class PsrLogMessageProcessor
+{
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        if (false === strpos($record['message'], '{')) {
+            return $record;
+        }
+
+        $replacements = array();
+        foreach ($record['context'] as $key => $val) {
+            $replacements['{'.$key.'}'] = $val;
+        }
+
+        $record['message'] = strtr($record['message'], $replacements);
+
+        return $record;
+    }
+}

vendor/monolog/monolog/src/Monolog/Processor/UidProcessor.php

@@ -0,0 +1,38 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Adds a unique identifier into records
+ *
+ * @author Simon Mönch <sm@webfactory.de>
+ */
+class UidProcessor
+{
+    private $uid;
+
+    public function __construct($length = 7)
+    {
+        if (!is_int($length) || $length > 32 || $length < 1) {
+            throw new \InvalidArgumentException('The uid length must be an integer between 1 and 32');
+        }
+
+        $this->uid = substr(hash('md5', uniqid('', true)), 0, $length);
+    }
+
+    public function __invoke(array $record)
+    {
+        $record['extra']['uid'] = $this->uid;
+
+        return $record;
+    }
+}

vendor/monolog/monolog/src/Monolog/Processor/WebProcessor.php

@@ -0,0 +1,62 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+/**
+ * Injects url/method and remote IP of the current web request in all records
+ *
+ * @author Jordi Boggiano <j.boggiano@seld.be>
+ */
+class WebProcessor
+{
+    protected $serverData;
+
+    /**
+     * @param mixed $serverData array or object w/ ArrayAccess that provides access to the $_SERVER data
+     */
+    public function __construct($serverData = null)
+    {
+        if (null === $serverData) {
+            $this->serverData =& $_SERVER;
+        } elseif (is_array($serverData) || $serverData instanceof \ArrayAccess) {
+            $this->serverData = $serverData;
+        } else {
+            throw new \UnexpectedValueException('$serverData must be an array or object implementing ArrayAccess.');
+        }
+    }
+
+    /**
+     * @param  array $record
+     * @return array
+     */
+    public function __invoke(array $record)
+    {
+        // skip processing if for some reason request data
+        // is not present (CLI or wonky SAPIs)
+        if (!isset($this->serverData['REQUEST_URI'])) {
+            return $record;
+        }
+
+        $record['extra'] = array_merge(
+            $record['extra'],
+            array(
+                'url'         => $this->serverData['REQUEST_URI'],
+                'ip'          => isset($this->serverData['REMOTE_ADDR']) ? $this->serverData['REMOTE_ADDR'] : null,
+                'http_method' => isset($this->serverData['REQUEST_METHOD']) ? $this->serverData['REQUEST_METHOD'] : null,
+                'server'      => isset($this->serverData['SERVER_NAME']) ? $this->serverData['SERVER_NAME'] : null,
+                'referrer'    => isset($this->serverData['HTTP_REFERER']) ? $this->serverData['HTTP_REFERER'] : null,
+            )
+        );
+
+        return $record;
+    }
+}

vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php

@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+
+class ErrorHandlerTest extends \PHPUnit_Framework_TestCase
+{
+    public function testHandleError()
+    {
+        $logger = new Logger('test', array($handler = new TestHandler));
+        $errHandler = new ErrorHandler($logger);
+
+        $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false);
+        trigger_error('Foo', E_USER_ERROR);
+        $this->assertCount(1, $handler->getRecords());
+        $this->assertTrue($handler->hasErrorRecords());
+        trigger_error('Foo', E_USER_NOTICE);
+        $this->assertCount(2, $handler->getRecords());
+        $this->assertTrue($handler->hasEmergencyRecords());
+    }
+}

vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php

@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testDefaultFormat()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                array(
+                    'message' => 'log',
+                    'context' => array('from' => 'logger'),
+                    'extra' => array('ip' => '127.0.0.1'),
+                ),
+                'unknown',
+                'error'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::CRITICAL,
+            'level_name' => 'CRITICAL',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                array(
+                    'message' => 'log',
+                    'context' => array('from' => 'logger'),
+                    'extra' => array('ip' => '127.0.0.1'),
+                ),
+                'test : 14',
+                'error'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testFormatWithoutContext()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::DEBUG,
+            'level_name' => 'DEBUG',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                'log',
+                'unknown',
+                'log'
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch
+     */
+    public function testBatchFormatThrowException()
+    {
+        $formatter = new ChromePHPFormatter();
+        $records = array(
+            array(
+                'level' => Logger::INFO,
+                'level_name' => 'INFO',
+                'channel' => 'meh',
+                'context' => array(),
+                'datetime' => new \DateTime("@0"),
+                'extra' => array(),
+                'message' => 'log',
+            ),
+            array(
+                'level' => Logger::WARNING,
+                'level_name' => 'WARNING',
+                'channel' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime("@0"),
+                'extra' => array(),
+                'message' => 'log2',
+            ),
+        );
+
+        $this->assertEquals(
+            array(
+                array(
+                    'meh',
+                    'log',
+                    'unknown',
+                    'info'
+                ),
+                array(
+                    'foo',
+                    'log2',
+                    'unknown',
+                    'warn'
+                ),
+            ),
+            $formatter->formatBatch($records)
+        );
+    }
+}

vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php

@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists("Gelf\Message")) {
+            $this->markTestSkipped("mlehner/gelf-php not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testDefaultFormatter()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals(0, $message->getTimestamp());
+        $this->assertEquals('log', $message->getShortMessage());
+        $this->assertEquals('meh', $message->getFacility());
+        $this->assertEquals(null, $message->getLine());
+        $this->assertEquals(null, $message->getFile());
+        $this->assertEquals(3, $message->getLevel());
+        $this->assertNotEmpty($message->getHost());
+
+        $formatter = new GelfMessageFormatter('mysystem');
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals('mysystem', $message->getHost());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals('test', $message->getFile());
+        $this->assertEquals(14, $message->getLine());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithContext()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_ctxt_from', $message_array);
+        $this->assertEquals('logger', $message_array['_ctxt_from']);
+
+        // Test with extraPrefix
+        $formatter = new GelfMessageFormatter(null, null, 'CTX');
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_CTXfrom', $message_array);
+        $this->assertEquals('logger', $message_array['_CTXfrom']);
+
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithExtra()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_key', $message_array);
+        $this->assertEquals('pair', $message_array['_key']);
+
+        // Test with extraPrefix
+        $formatter = new GelfMessageFormatter(null, 'EXT');
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_EXTkey', $message_array);
+        $this->assertEquals('pair', $message_array['_EXTkey']);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php

@@ -0,0 +1,41 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class JsonFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::format
+     */
+    public function testFormat()
+    {
+        $formatter = new JsonFormatter();
+        $record = $this->getRecord();
+        $this->assertEquals(json_encode($record), $formatter->format($record));
+    }
+
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::formatBatch
+     */
+    public function testFormatBatch()
+    {
+        $formatter = new JsonFormatter();
+        $records = array(
+            $this->getRecord(Logger::WARNING),
+            $this->getRecord(Logger::DEBUG),
+        );
+        $this->assertEquals(json_encode($records), $formatter->formatBatch($records));
+    }
+}

vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php

@@ -0,0 +1,164 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\LineFormatter
+ */
+class LineFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function testDefFormatWithString()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'WARNING',
+            'channel' => 'log',
+            'context' => array(),
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array(),
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+    }
+
+    public function testDefFormatWithArrayContext()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+            )
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux"} []'."\n", $message);
+    }
+
+    public function testDefFormatExtras()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message);
+    }
+
+    public function testFormatExtras()
+    {
+        $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test'),
+            'message' => 'log',
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message);
+    }
+
+    public function testDefFormatWithObject()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+            'message' => 'foobar',
+        ));
+
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: {})","baz":[],"res":"[resource]"}'."\n", $message);
+    }
+
+    public function testDefFormatWithException()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'core',
+            'context' => array('exception' => new \RuntimeException('Foo')),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'message' => 'foobar',
+        ));
+
+        $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+        $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException: Foo at '.substr($path, 1, -1).':'.(__LINE__-8).')"} []'."\n", $message);
+    }
+
+    public function testDefFormatWithPreviousException()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $previous = new \LogicException('Wut?');
+        $message = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'core',
+            'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'message' => 'foobar',
+        ));
+
+        $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+        $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException: Foo at '.substr($path, 1, -1).':'.(__LINE__-8).', LogicException: Wut? at '.substr($path, 1, -1).':'.(__LINE__-12).')"} []'."\n", $message);
+    }
+
+    public function testBatchFormat()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->formatBatch(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+    }
+}
+
+class TestFoo
+{
+    public $foo = 'foo';
+}
+
+class TestBar
+{
+    public function __toString()
+    {
+        return 'bar';
+    }
+}

vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php

@@ -0,0 +1,160 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\Formatter\LogstashFormatter;
+
+class LogstashFormatterTest extends \PHPUnit_Framework_TestCase
+{
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testDefaultFormatter()
+    {
+        $formatter = new LogstashFormatter('test', 'hostname');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals("1970-01-01T00:00:00+00:00", $message['@timestamp']);
+        $this->assertEquals('log', $message['@message']);
+        $this->assertEquals('meh', $message['@fields']['channel']);
+        $this->assertContains('meh', $message['@tags']);
+        $this->assertEquals(Logger::ERROR, $message['@fields']['level']);
+        $this->assertEquals('test', $message['@type']);
+        $this->assertEquals('hostname', $message['@source']);
+
+        $formatter = new LogstashFormatter('mysystem');
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('mysystem', $message['@type']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('test', $message['@fields']['file']);
+        $this->assertEquals(14, $message['@fields']['line']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithContext()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('ctxt_from', $message_array);
+        $this->assertEquals('logger', $message_array['ctxt_from']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, null, 'CTX');
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('CTXfrom', $message_array);
+        $this->assertEquals('logger', $message_array['CTXfrom']);
+
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithExtra()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('key', $message_array);
+        $this->assertEquals('pair', $message_array['key']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, 'EXT');
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('EXTkey', $message_array);
+        $this->assertEquals('pair', $message_array['EXTkey']);
+    }
+
+    public function testFormatWithApplicationName()
+    {
+        $formatter = new LogstashFormatter('app', 'test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log'
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('@type', $message);
+        $this->assertEquals('app', $message['@type']);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php

@@ -0,0 +1,182 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\NormalizerFormatter
+ */
+class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function testFormat()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $formatted = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+            ),
+        ));
+
+        $this->assertEquals(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => date('Y-m-d'),
+            'extra' => array(
+                'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})',
+                'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: {})',
+                'baz' => array(),
+                'res' => '[resource]',
+            ),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+            )
+        ), $formatted);
+    }
+
+    public function testFormatExceptions()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $e = new \LogicException('bar');
+        $e2 = new \RuntimeException('foo', 0, $e);
+        $formatted = $formatter->format(array(
+            'exception' => $e2,
+        ));
+
+        $this->assertGreaterThan(5, count($formatted['exception']['trace']));
+        $this->assertTrue(isset($formatted['exception']['previous']));
+        unset($formatted['exception']['trace'], $formatted['exception']['previous']);
+
+        $this->assertEquals(array(
+            'exception' => array(
+                'class'   => get_class($e2),
+                'message' => $e2->getMessage(),
+                'file'   => $e2->getFile().':'.$e2->getLine(),
+            )
+        ), $formatted);
+    }
+
+    public function testBatchFormat()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $formatted = $formatter->formatBatch(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+        ));
+        $this->assertEquals(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => date('Y-m-d'),
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => date('Y-m-d'),
+                'extra' => array(),
+            ),
+        ), $formatted);
+    }
+
+    /**
+     * Test issue #137
+     */
+    public function testIgnoresRecursiveObjectReferences()
+    {
+        // set up the recursion
+        $foo = new \stdClass();
+        $bar = new \stdClass();
+
+        $foo->bar = $bar;
+        $bar->foo = $foo;
+
+        // set an error handler to assert that the error is not raised anymore
+        $that = $this;
+        set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+            if (error_reporting() & $level) {
+                restore_error_handler();
+                $that->fail("$message should not be raised");
+            }
+        });
+
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+        $reflMethod->setAccessible(true);
+        $res = $reflMethod->invoke($formatter, array($foo, $bar), true);
+
+        restore_error_handler();
+
+        $this->assertEquals(@json_encode(array($foo, $bar)), $res);
+    }
+
+    public function testIgnoresInvalidTypes()
+    {
+        // set up the recursion
+        $resource = fopen(__FILE__, 'r');
+
+        // set an error handler to assert that the error is not raised anymore
+        $that = $this;
+        set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+            if (error_reporting() & $level) {
+                restore_error_handler();
+                $that->fail("$message should not be raised");
+            }
+        });
+
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+        $reflMethod->setAccessible(true);
+        $res = $reflMethod->invoke($formatter, array($resource), true);
+
+        restore_error_handler();
+
+        $this->assertEquals(@json_encode(array($resource)), $res);
+    }
+}
+
+class TestFooNorm
+{
+    public $foo = 'foo';
+}
+
+class TestBarNorm
+{
+    public function __toString()
+    {
+        return 'bar';
+    }
+}

vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php

@@ -0,0 +1,111 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class WildfireFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testDefaultFormat()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},'
+                .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},'
+                .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testFormatWithoutContext()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::formatBatch
+     * @expectedException BadMethodCallException
+     */
+    public function testBatchFormatThrowException()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $wildfire->formatBatch(array($record));
+    }
+}

vendor/monolog/monolog/tests/Monolog/Functional/Handler/FirePHPHandlerTest.php

@@ -0,0 +1,32 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+spl_autoload_register(function($class) {
+    $file = __DIR__.'/../../../../src/'.strtr($class, '\\', '/').'.php';
+    if (file_exists($file)) {
+        require $file;
+
+        return true;
+    }
+});
+
+use Monolog\Logger;
+use Monolog\Handler\FirePHPHandler;
+use Monolog\Handler\ChromePHPHandler;
+
+$logger = new Logger('firephp');
+$logger->pushHandler(new FirePHPHandler);
+$logger->pushHandler(new ChromePHPHandler());
+
+$logger->addDebug('Debug');
+$logger->addInfo('Info');
+$logger->addWarning('Warning');
+$logger->addError('Error');

vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php

@@ -0,0 +1,104 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\WebProcessor;
+
+class AbstractHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\AbstractHandler::__construct
+     * @covers Monolog\Handler\AbstractHandler::getLevel
+     * @covers Monolog\Handler\AbstractHandler::setLevel
+     * @covers Monolog\Handler\AbstractHandler::getBubble
+     * @covers Monolog\Handler\AbstractHandler::setBubble
+     * @covers Monolog\Handler\AbstractHandler::getFormatter
+     * @covers Monolog\Handler\AbstractHandler::setFormatter
+     */
+    public function testConstructAndGetSet()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+        $this->assertEquals(Logger::WARNING, $handler->getLevel());
+        $this->assertEquals(false, $handler->getBubble());
+
+        $handler->setLevel(Logger::ERROR);
+        $handler->setBubble(true);
+        $handler->setFormatter($formatter = new LineFormatter);
+        $this->assertEquals(Logger::ERROR, $handler->getLevel());
+        $this->assertEquals(true, $handler->getBubble());
+        $this->assertSame($formatter, $handler->getFormatter());
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $handler->expects($this->exactly(2))
+            ->method('handle');
+        $handler->handleBatch(array($this->getRecord(), $this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+        $this->assertTrue($handler->isHandling($this->getRecord()));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::getFormatter
+     * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter
+     */
+    public function testGetFormatterInitializesDefault()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter());
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::pushProcessor
+     * @covers Monolog\Handler\AbstractHandler::popProcessor
+     * @expectedException LogicException
+     */
+    public function testPushPopProcessor()
+    {
+        $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+
+        $logger->pushProcessor($processor1);
+        $logger->pushProcessor($processor2);
+
+        $this->assertEquals($processor2, $logger->popProcessor());
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $logger->popProcessor();
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::pushProcessor
+     * @expectedException InvalidArgumentException
+     */
+    public function testPushProcessorWithNonCallable()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+
+        $handler->pushProcessor(new \stdClass());
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php

@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Processor\WebProcessor;
+
+class AbstractProcessingHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleLowerLevelMessage()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleBubbling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true));
+        $this->assertFalse($handler->handle($this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleNotBubbling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false));
+        $this->assertTrue($handler->handle($this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleIsFalseWhenNotHandled()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false));
+        $this->assertTrue($handler->handle($this->getRecord()));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::processRecord
+     */
+    public function testProcessRecord()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler');
+        $handler->pushProcessor(new WebProcessor(array(
+            'REQUEST_URI' => '',
+            'REQUEST_METHOD' => '',
+            'REMOTE_ADDR' => '',
+            'SERVER_NAME' => '',
+        )));
+        $handledRecord = null;
+        $handler->expects($this->once())
+            ->method('write')
+            ->will($this->returnCallback(function($record) use (&$handledRecord) {
+                $handledRecord = $record;
+            }))
+        ;
+        $handler->handle($this->getRecord());
+        $this->assertEquals(5, count($handledRecord['extra']));
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/AmqpExchangeMock.php

@@ -0,0 +1,38 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+class AmqpExchangeMock extends \AMQPExchange
+{
+    protected $messages = array();
+
+    public function __construct()
+    {
+    }
+
+    public function publish($message, $routing_key, $params = 0, $attributes = array())
+    {
+        $this->messages[] = array($message, $routing_key, $params, $attributes);
+
+        return true;
+    }
+
+    public function getMessages()
+    {
+        return $this->messages;
+    }
+
+    public function setName($name)
+    {
+        return true;
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php

@@ -0,0 +1,74 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class AmqpHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) {
+            $this->markTestSkipped("amqp-php not installed");
+        }
+
+        if (!class_exists('AMQPChannel')) {
+            $this->markTestSkipped("Please update AMQP to version >= 1.0");
+        }
+    }
+
+    public function testHandle()
+    {
+        $exchange = $this->getExchange();
+
+        $handler = new AmqpHandler($exchange, 'log');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            array(
+                'message' => 'test',
+                'context' => array(
+                    'data' => array(),
+                    'foo' => 34,
+                ),
+                'level' => 300,
+                'level_name' => 'WARNING',
+                'channel' => 'test',
+                'extra' => array(),
+            ),
+            'warn.test',
+            0,
+            array(
+                'delivery_mode' => 2,
+                'Content-type' => 'application/json'
+            )
+        );
+
+        $handler->handle($record);
+
+        $messages = $exchange->getMessages();
+        $this->assertCount(1, $messages);
+        $messages[0][0] = json_decode($messages[0][0], true);
+        unset($messages[0][0]['datetime']);
+        $this->assertEquals($expected, $messages[0]);
+    }
+
+    protected function getExchange()
+    {
+        return new AmqpExchangeMock();
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php

@@ -0,0 +1,149 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class BufferHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\BufferHandler::__construct
+     * @covers Monolog\Handler\BufferHandler::handle
+     * @covers Monolog\Handler\BufferHandler::close
+     */
+    public function testHandleBuffers()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->close();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 2);
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::close
+     * @covers Monolog\Handler\BufferHandler::flush
+     */
+    public function testDestructPropagatesRecords()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->__destruct();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleBufferLimit()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 2);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleBufferLimitWithFlushOnOverflow()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true);
+
+        // send two records
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertCount(0, $test->getRecords());
+
+        // overflow
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertCount(3, $test->getRecords());
+
+        // should buffer again
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertCount(3, $test->getRecords());
+
+        $handler->close();
+        $this->assertCount(5, $test->getRecords());
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleLevel()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 0, Logger::INFO);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::flush
+     */
+    public function testFlush()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 0);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->flush();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->flush();
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php

@@ -0,0 +1,139 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\ChromePHPHandler
+ */
+class ChromePHPHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        TestChromePHPHandler::reset();
+    }
+
+    public function testHeaders()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    'test',
+                    'test',
+                ),
+                'request_uri' => '',
+            ))))
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testHeadersOverflow()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150*1024)));
+
+        // overflow chrome headers limit
+        $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100*1024)));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    array(
+                        'test',
+                        'test',
+                        'unknown',
+                        'log',
+                    ),
+                    array(
+                        'test',
+                        str_repeat('a', 150*1024),
+                        'unknown',
+                        'warn',
+                    ),
+                    array(
+                        'monolog',
+                        'Incomplete logs, chrome header size limit reached',
+                        'unknown',
+                        'warn',
+                    ),
+                ),
+                'request_uri' => '',
+            ))))
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $handler2 = new TestChromePHPHandler();
+        $handler2->setFormatter($this->getIdentityFormatter());
+        $handler2->handle($this->getRecord(Logger::DEBUG));
+        $handler2->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    'test',
+                    'test',
+                    'test',
+                    'test',
+                ),
+                'request_uri' => '',
+            ))))
+        );
+
+        $this->assertEquals($expected, $handler2->getHeaders());
+    }
+}
+
+class TestChromePHPHandler extends ChromePHPHandler
+{
+    protected $headers = array();
+
+    public static function reset()
+    {
+        self::$initialized = false;
+        self::$overflowed = false;
+        self::$json['rows'] = array();
+    }
+
+    protected function sendHeader($header, $content)
+    {
+        $this->headers[$header] = $content;
+    }
+
+    public function getHeaders()
+    {
+        return $this->headers;
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php

@@ -0,0 +1,41 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class CouchDBHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $handler = new CouchDBHandler();
+
+        try {
+            $handler->handle($record);
+        } catch (\RuntimeException $e) {
+            $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984');
+        }
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php

@@ -0,0 +1,52 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class DoctrineCouchDBHandlerTest extends TestCase
+{
+    protected function setup()
+    {
+        if (!class_exists('Doctrine\CouchDB\CouchDBClient')) {
+            $this->markTestSkipped('The "doctrine/couchdb" package is not installed');
+        }
+    }
+
+    public function testHandle()
+    {
+        $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient')
+            ->setMethods(array('postDocument'))
+            ->disableOriginalConstructor()
+            ->getMock();
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $client->expects($this->once())
+            ->method('postDocument')
+            ->with($expected);
+
+        $handler = new DoctrineCouchDBHandler($client);
+        $handler->handle($record);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php

@@ -0,0 +1,43 @@
+<?php
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+function error_log()
+{
+    $GLOBALS['error_log'] = func_get_args();
+}
+
+class ErrorLogHandlerTest extends TestCase
+{
+
+    protected function setUp()
+    {
+        $GLOBALS['error_log'] = array();
+    }
+
+    /**
+     * @covers Monolog\Handler\ErrorLogHandler::__construct
+     * @expectedException InvalidArgumentException
+     * @expectedExceptionMessage The given message type "42" is not supported
+     */
+    public function testShouldNotAcceptAnInvalidTypeOnContructor()
+    {
+        new ErrorLogHandler(42);
+    }
+
+    /**
+     * @covers Monolog\Handler\ErrorLogHandler::write
+     */
+    public function testShouldLogMessagesUsingErrorLogFuncion()
+    {
+        $type = ErrorLogHandler::OPERATING_SYSTEM;
+        $handler = new ErrorLogHandler($type);
+        $handler->handle($this->getRecord(Logger::ERROR));
+
+        $this->assertStringMatchesFormat('[%s] test.ERROR: test [] []', $GLOBALS['error_log'][0]);
+        $this->assertSame($GLOBALS['error_log'][1], $type);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php

@@ -0,0 +1,189 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy;
+
+class FingersCrossedHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleBuffers()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 3);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleStopsBufferingAfterTrigger()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::reset
+     */
+    public function testHandleRestartBufferingAfterReset()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->reset();
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleRestartBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleBufferLimit()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::WARNING, 2);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleWithCallback()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler(function($record, $handler) use ($test) {
+                    return $test;
+                });
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 3);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @expectedException RuntimeException
+     */
+    public function testHandleWithBadCallbackThrowsException()
+    {
+        $handler = new FingersCrossedHandler(function($record, $handler) {
+                    return 'foo';
+                });
+        $handler->handle($this->getRecord(Logger::WARNING));
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::isHandling
+     */
+    public function testIsHandlingAlways()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::ERROR);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+     */
+    public function testErrorLevelActivationStrategy()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+     */
+    public function testChannelLevelActivationStrategy()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG)));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertFalse($test->hasWarningRecords());
+        $record = $this->getRecord(Logger::DEBUG);
+        $record['channel'] = 'othertest';
+        $handler->handle($record);
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::INFO);
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php

@@ -0,0 +1,94 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\FirePHPHandler
+ */
+class FirePHPHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        TestFirePHPHandler::reset();
+    }
+
+    public function testHeaders()
+    {
+        $handler = new TestFirePHPHandler;
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-Wf-Protocol-1'    => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+            'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+            'X-Wf-1-Plugin-1'    => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+            'X-Wf-1-1-1-1'       => 'test',
+            'X-Wf-1-1-1-2'       => 'test',
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler = new TestFirePHPHandler;
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $handler2 = new TestFirePHPHandler;
+        $handler2->setFormatter($this->getIdentityFormatter());
+        $handler2->handle($this->getRecord(Logger::DEBUG));
+        $handler2->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-Wf-Protocol-1'    => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+            'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+            'X-Wf-1-Plugin-1'    => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+            'X-Wf-1-1-1-1'       => 'test',
+            'X-Wf-1-1-1-2'       => 'test',
+        );
+
+        $expected2 = array(
+            'X-Wf-1-1-1-3'       => 'test',
+            'X-Wf-1-1-1-4'       => 'test',
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+        $this->assertEquals($expected2, $handler2->getHeaders());
+    }
+}
+
+class TestFirePHPHandler extends FirePHPHandler
+{
+    protected $headers = array();
+
+    public static function reset()
+    {
+        self::$initialized = false;
+        self::$messageIndex = 1;
+    }
+
+    protected function sendHeader($header, $content)
+    {
+        $this->headers[$header] = $content;
+    }
+
+    public function getHeaders()
+    {
+        return $this->headers;
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php

@@ -0,0 +1,94 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists("Gelf\MessagePublisher") || !class_exists("Gelf\Message")) {
+            $this->markTestSkipped("mlehner/gelf-php not installed");
+        }
+
+        require_once __DIR__ . '/GelfMocks.php';
+    }
+
+    /**
+     * @covers Monolog\Handler\GelfHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new GelfHandler($this->getMessagePublisher());
+        $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+    }
+
+    protected function getHandler($messagePublisher)
+    {
+        $handler = new GelfHandler($messagePublisher);
+
+        return $handler;
+    }
+
+    protected function getMessagePublisher()
+    {
+        return new MockMessagePublisher('localhost');
+    }
+
+    public function testDebug()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+        $handler->handle($record);
+
+        $this->assertEquals(7, $messagePublisher->lastMessage->getLevel());
+        $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+        $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+        $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+    }
+
+    public function testWarning()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $handler->handle($record);
+
+        $this->assertEquals(4, $messagePublisher->lastMessage->getLevel());
+        $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+        $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+        $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+    }
+
+    public function testInjectedGelfMessageFormatter()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $record['extra']['blarg'] = 'yep';
+        $record['context']['from'] = 'logger';
+        $handler->handle($record);
+
+        $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost());
+        $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray());
+        $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray());
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/GelfMocks.php

@@ -0,0 +1,25 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\MessagePublisher;
+use Gelf\Message;
+
+class MockMessagePublisher extends MessagePublisher
+{
+    public function publish(Message $message)
+    {
+        $this->lastMessage = $message;
+    }
+
+    public $lastMessage = null;
+}

vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php

@@ -0,0 +1,89 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class GroupHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\GroupHandler::__construct
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorOnlyTakesHandler()
+    {
+        new GroupHandler(array(new TestHandler(), "foo"));
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::__construct
+     * @covers Monolog\Handler\GroupHandler::handle
+     */
+    public function testHandle()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+        $handler = new GroupHandler($testHandlers);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new GroupHandler(array($test));
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php

@@ -0,0 +1,110 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Rafael Dohms <rafael@doh.ms>
+ * @see    https://www.hipchat.com/docs/api
+ */
+class HipChatHandlerTest extends TestCase
+{
+
+    private $res;
+    private $handler;
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteHeader
+     */
+    public function testWriteContent($content)
+    {
+        $this->assertRegexp('/from=Monolog&room_id=room1&notify=0&message=test1&message_format=text&color=red$/', $content);
+    }
+
+    public function testWriteWithComplexMessage()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+    }
+
+    /**
+     * @dataProvider provideLevelColors
+     */
+    public function testWriteWithErrorLevelsAndColors($level, $expectedColor)
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/color='.$expectedColor.'/', $content);
+    }
+
+    public function provideLevelColors()
+    {
+        return array(
+            array(Logger::DEBUG,    'gray'),
+            array(Logger::INFO,     'green'),
+            array(Logger::WARNING,  'yellow'),
+            array(Logger::ERROR,    'red'),
+            array(Logger::CRITICAL, 'red'),
+            array(Logger::ALERT,    'red'),
+            array(Logger::EMERGENCY,'red'),
+            array(Logger::NOTICE,   'green'),
+        );
+    }
+
+    private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false)
+    {
+        $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\HipChatHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php

@@ -0,0 +1,75 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class MailHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\MailHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->once())
+            ->method('formatBatch'); // Each record is formatted
+
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+        $handler->expects($this->once())
+            ->method('send');
+        $handler->expects($this->never())
+            ->method('write'); // write is for individual records
+
+        $handler->setFormatter($formatter);
+
+        $handler->handleBatch($this->getMultipleRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\MailHandler::handleBatch
+     */
+    public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel()
+    {
+        $records = array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+        );
+
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+        $handler->expects($this->never())
+            ->method('send');
+        $handler->setLevel(Logger::ERROR);
+
+        $handler->handleBatch($records);
+    }
+
+    /**
+     * @covers Monolog\Handler\MailHandler::write
+     */
+    public function testHandle()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+
+        $record = $this->getRecord();
+        $records = array($record);
+        $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n";
+
+        $handler->expects($this->once())
+            ->method('send')
+            ->with($records[0]['formatted'], $records);
+
+        $handler->handle($record);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php

@@ -0,0 +1,26 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Raven_Client;
+
+class MockRavenClient extends Raven_Client
+{
+    public function capture($data, $stack, $vars = null)
+    {
+        $this->lastData = $data;
+        $this->lastStack = $stack;
+    }
+
+    public $lastData;
+    public $lastStack;
+}

vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php

@@ -0,0 +1,63 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class MongoDBHandlerTest extends TestCase
+{
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorShouldThrowExceptionForInvalidMongo()
+    {
+        new MongoDBHandler(new \stdClass(), 'DB', 'Collection');
+    }
+
+    public function testHandle()
+    {
+        $mongo = $this->getMock('Mongo', array('selectCollection'));
+        $collection = $this->getMock('stdClass', array('save'));
+
+        $mongo->expects($this->once())
+            ->method('selectCollection')
+            ->with('DB', 'Collection')
+            ->will($this->returnValue($collection));
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $collection->expects($this->once())
+            ->method('save')
+            ->with($expected);
+
+        $handler = new MongoDBHandler($mongo, 'DB', 'Collection');
+        $handler->handle($record);
+    }
+}
+
+if (!class_exists('Mongo')) {
+    class Mongo
+    {
+        public function selectCollection() {}
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php

@@ -0,0 +1,43 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class NativeMailerHandlerTest extends TestCase
+{
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org");
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org");
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterArrayHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org"));
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php

@@ -0,0 +1,102 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Psr\Log\LogLevel;
+
+class NewRelicHandlerTest extends TestCase
+{
+    public static $appname;
+
+    public function setUp()
+    {
+        $this::$appname = null;
+    }
+
+    /**
+     * @expectedException Monolog\Handler\MissingExtensionException
+     */
+    public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded()
+    {
+        $handler = new StubNewRelicHandlerWithoutExtension();
+        $handler->handle($this->getRecord(Logger::ERROR));
+    }
+
+    public function testThehandlerCanHandleTheRecord()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR));
+    }
+
+    public function testThehandlerCanAddParamsToTheNewRelicTrace()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')));
+    }
+
+    public function testTheAppNameIsNullByDefault()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals(null, $this::$appname);
+    }
+
+    public function testTheAppNameCanBeInjectedFromtheConstructor()
+    {
+        $handler = new StubNewRelicHandler(LogLevel::ALERT, false, 'myAppName');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals('myAppName', $this::$appname);
+    }
+
+    public function testTheAppNameCanBeOverriddenFromEachLog()
+    {
+        $handler = new StubNewRelicHandler(LogLevel::ALERT, false, 'myAppName');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName')));
+
+        $this->assertEquals('logAppName', $this::$appname);
+    }
+}
+
+class StubNewRelicHandlerWithoutExtension extends NewRelicHandler
+{
+    protected function isNewRelicEnabled()
+    {
+        return false;
+    }
+}
+
+class StubNewRelicHandler extends NewRelicHandler
+{
+    protected function isNewRelicEnabled()
+    {
+        return true;
+    }
+}
+
+function newrelic_notice_error()
+{
+    return true;
+}
+
+function newrelic_set_appname($appname)
+{
+    return NewRelicHandlerTest::$appname = $appname;
+}
+
+function newrelic_add_custom_parameter()
+{
+    return true;
+}

vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php

@@ -0,0 +1,33 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\NullHandler::handle
+ */
+class NullHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $handler = new NullHandler();
+        $this->assertTrue($handler->handle($this->getRecord()));
+    }
+
+    public function testHandleLowerLevelRecord()
+    {
+        $handler = new NullHandler(Logger::WARNING);
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php

@@ -0,0 +1,142 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * Almost all examples (expected header, titles, messages) taken from
+ * https://www.pushover.net/api
+ * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com>
+ * @see https://www.pushover.net/api
+ */
+class PushoverHandlerTest extends TestCase
+{
+
+    private $res;
+    private $handler;
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteHeader
+     */
+    public function testWriteContent($content)
+    {
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}$/', $content);
+    }
+
+    public function testWriteWithComplexTitle()
+    {
+        $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1', Logger::EMERGENCY);
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content);
+    }
+
+    public function testWriteWithComplexMessage()
+    {
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+    }
+
+    public function testWriteWithTooLongMessage()
+    {
+        $message = str_pad('test', 520, 'a');
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, $message));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $expectedMessage = substr($message, 0, 505);
+
+        $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content);
+    }
+
+    public function testWriteWithHighPriority()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}&priority=1$/', $content);
+    }
+
+    public function testWriteWithEmergencyPriority()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+    }
+
+    public function testWriteToMultipleUsers()
+    {
+        $this->createHandler('myToken', array('userA', 'userB'));
+        $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content);
+        $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+    }
+
+    private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog')
+    {
+        $constructorArgs = array($token, $user, $title);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\PushoverHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php

@@ -0,0 +1,135 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Handler\RavenHandler;
+
+class RavenHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists("Raven_Client")) {
+            $this->markTestSkipped("raven/raven not installed");
+        }
+
+        require_once __DIR__ . '/MockRavenClient.php';
+    }
+
+    /**
+     * @covers Monolog\Handler\RavenHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new RavenHandler($this->getRavenClient());
+        $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler);
+    }
+
+    protected function getHandler($ravenClient)
+    {
+        $handler = new RavenHandler($ravenClient);
+
+        return $handler;
+    }
+
+    protected function getRavenClient()
+    {
+        $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1';
+
+        return new MockRavenClient($dsn);
+    }
+
+    public function testDebug()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+        $handler->handle($record);
+
+        $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']);
+        $this->assertContains($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testWarning()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $handler->handle($record);
+
+        $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']);
+        $this->assertContains($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testException()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        try {
+            $this->methodThatThrowsAnException();
+        } catch (\Exception $e) {
+            $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e));
+            $handler->handle($record);
+        }
+
+        $this->assertEquals($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testHandleBatch()
+    {
+        $records = $this->getMultipleRecords();
+
+        $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $logFormatter->expects($this->once())->method('formatBatch');
+
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->once())->method('format');
+
+        $handler = $this->getHandler($this->getRavenClient());
+        $handler->setBatchFormatter($logFormatter);
+        $handler->setFormatter($formatter);
+        $handler->handleBatch($records);
+    }
+
+    public function testHandleBatchDoNothingIfRecordsAreBelowLevel()
+    {
+        $records = array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+        );
+
+        $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient()));
+        $handler->expects($this->never())->method('handle');
+        $handler->setLevel(Logger::ERROR);
+        $handler->handleBatch($records);
+    }
+
+    public function testGetSetBatchFormatter()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $handler->setBatchFormatter($formatter = new LineFormatter());
+        $this->assertSame($formatter, $handler->getBatchFormatter());
+    }
+
+    private function methodThatThrowsAnException()
+    {
+        throw new \Exception('This is an exception');
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php

@@ -0,0 +1,71 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RedisHandlerTest extends TestCase
+{
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorShouldThrowExceptionForInvalidRedis()
+    {
+        new RedisHandler(new \stdClass(), 'key');
+    }
+
+    public function testConstructorShouldWorkWithPredis()
+    {
+        $redis = $this->getMock('Predis\Client');
+        $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+    }
+
+    public function testConstructorShouldWorkWithRedis()
+    {
+        $redis = $this->getMock('Redis');
+        $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+    }
+
+    public function testPredisHandle()
+    {
+        $redis = $this->getMock('Predis\Client', array('rpush'));
+
+        // Predis\Client uses rpush
+        $redis->expects($this->once())
+            ->method('rpush')
+            ->with('key', 'test');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new RedisHandler($redis, 'key');
+        $handler->setFormatter(new LineFormatter("%message%"));
+        $handler->handle($record);
+    }
+
+    public function testRedisHandle()
+    {
+        $redis = $this->getMock('Redis', array('rpush'));
+
+        // Redis uses rPush
+        $redis->expects($this->once())
+            ->method('rPush')
+            ->with('key', 'test');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new RedisHandler($redis, 'key');
+        $handler->setFormatter(new LineFormatter("%message%"));
+        $handler->handle($record);
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php

@@ -0,0 +1,99 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class RotatingFileHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        $dir = __DIR__.'/Fixtures';
+        chmod($dir, 0777);
+        if (!is_writable($dir)) {
+            $this->markTestSkipped($dir.' must be writeable to test the RotatingFileHandler.');
+        }
+    }
+
+    public function testRotationCreatesNewFile()
+    {
+        touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+        $this->assertTrue(file_exists($log));
+        $this->assertEquals('test', file_get_contents($log));
+    }
+
+    /**
+     * @dataProvider rotationTests
+     */
+    public function testRotation($createFile)
+    {
+        touch($old1 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+        touch($old2 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 2).'.rot');
+        touch($old3 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 3).'.rot');
+        touch($old4 = __DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400 * 4).'.rot');
+
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+
+        if ($createFile) {
+            touch($log);
+        }
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+
+        $handler->close();
+
+        $this->assertTrue(file_exists($log));
+        $this->assertTrue(file_exists($old1));
+        $this->assertEquals($createFile, file_exists($old2));
+        $this->assertEquals($createFile, file_exists($old3));
+        $this->assertEquals($createFile, file_exists($old4));
+        $this->assertEquals('test', file_get_contents($log));
+    }
+
+    public function rotationTests()
+    {
+        return array(
+            'Rotation is triggered when the file of the current day is not present'
+                => array(true),
+            'Rotation is not triggered when the file is already present'
+                => array(false),
+        );
+    }
+
+    public function testReuseCurrentFile()
+    {
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+        file_put_contents($log, "foo");
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+        $this->assertEquals('footest', file_get_contents($log));
+    }
+
+    public function tearDown()
+    {
+        foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) {
+            unlink($file);
+        }
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php

@@ -0,0 +1,283 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ */
+class SocketHandlerTest extends TestCase
+{
+    /**
+     * @var Monolog\Handler\SocketHandler
+     */
+    private $handler;
+
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testInvalidHostname()
+    {
+        $this->createHandler('garbage://here');
+        $this->writeRecord('data');
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     */
+    public function testBadConnectionTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setConnectionTimeout(-1);
+    }
+
+    public function testSetConnectionTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setConnectionTimeout(10.1);
+        $this->assertEquals(10.1, $this->handler->getConnectionTimeout());
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     */
+    public function testBadTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setTimeout(-1);
+    }
+
+    public function testSetTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setTimeout(10.25);
+        $this->assertEquals(10.25, $this->handler->getTimeout());
+    }
+
+    public function testSetConnectionString()
+    {
+        $this->createHandler('tcp://localhost:9090');
+        $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownOnFsockopenError()
+    {
+        $this->setMockHandler(array('fsockopen'));
+        $this->handler->expects($this->once())
+            ->method('fsockopen')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownOnPfsockopenError()
+    {
+        $this->setMockHandler(array('pfsockopen'));
+        $this->handler->expects($this->once())
+            ->method('pfsockopen')
+            ->will($this->returnValue(false));
+        $this->handler->setPersistent(true);
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownIfCannotSetTimeout()
+    {
+        $this->setMockHandler(array('streamSetTimeout'));
+        $this->handler->expects($this->once())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsOnIfFwriteReturnsFalse()
+    {
+        $this->setMockHandler(array('fwrite'));
+
+        $callback = function($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => false,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(2))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsIfStreamTimesOut()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $callback = function($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => 5,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(1))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+        $this->handler->expects($this->exactly(1))
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => true)));
+
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsOnIncompleteWrite()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $res = $this->res;
+        $callback = function($string) use ($res) {
+            fclose($res);
+
+            return strlen('Hello');
+        };
+
+        $this->handler->expects($this->exactly(1))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+        $this->handler->expects($this->exactly(1))
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => false)));
+
+        $this->writeRecord('Hello world');
+    }
+
+    public function testWriteWithMemoryFile()
+    {
+        $this->setMockHandler();
+        $this->writeRecord('test1');
+        $this->writeRecord('test2');
+        $this->writeRecord('test3');
+        fseek($this->res, 0);
+        $this->assertEquals('test1test2test3', fread($this->res, 1024));
+    }
+
+    public function testWriteWithMock()
+    {
+        $this->setMockHandler(array('fwrite'));
+
+        $callback = function($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => 5,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(2))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+
+        $this->writeRecord('Hello world');
+    }
+
+    public function testClose()
+    {
+        $this->setMockHandler();
+        $this->writeRecord('Hello world');
+        $this->assertInternalType('resource', $this->res);
+        $this->handler->close();
+        $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler");
+    }
+
+    public function testCloseDoesNotClosePersistentSocket()
+    {
+        $this->setMockHandler();
+        $this->handler->setPersistent(true);
+        $this->writeRecord('Hello world');
+        $this->assertTrue(is_resource($this->res));
+        $this->handler->close();
+        $this->assertTrue(is_resource($this->res));
+    }
+
+    private function createHandler($connectionString)
+    {
+        $this->handler = new SocketHandler($connectionString);
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+
+    private function writeRecord($string)
+    {
+        $this->handler->handle($this->getRecord(Logger::WARNING, $string));
+    }
+
+    private function setMockHandler(array $methods = array())
+    {
+        $this->res = fopen('php://memory', 'a');
+
+        $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout');
+        $newMethods = array_diff($methods, $defaultMethods);
+
+        $finalMethods = array_merge($defaultMethods, $newMethods);
+
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234')
+        );
+
+        if (!in_array('fsockopen', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('fsockopen')
+                ->will($this->returnValue($this->res));
+        }
+
+        if (!in_array('pfsockopen', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('pfsockopen')
+                ->will($this->returnValue($this->res));
+        }
+
+        if (!in_array('streamSetTimeout', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('streamSetTimeout')
+                ->will($this->returnValue(true));
+        }
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+
+}

vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php

@@ -0,0 +1,88 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class StreamHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWrite()
+    {
+        $handle = fopen('php://memory', 'a+');
+        $handler = new StreamHandler($handle);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::WARNING, 'test'));
+        $handler->handle($this->getRecord(Logger::WARNING, 'test2'));
+        $handler->handle($this->getRecord(Logger::WARNING, 'test3'));
+        fseek($handle, 0);
+        $this->assertEquals('testtest2test3', fread($handle, 100));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::close
+     */
+    public function testClose()
+    {
+        $handle = fopen('php://memory', 'a+');
+        $handler = new StreamHandler($handle);
+        $this->assertTrue(is_resource($handle));
+        $handler->close();
+        $this->assertFalse(is_resource($handle));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteCreatesTheStreamResource()
+    {
+        $handler = new StreamHandler('php://memory');
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException LogicException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteMissingResource()
+    {
+        $handler = new StreamHandler(null);
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteInvalidResource()
+    {
+        $handler = new StreamHandler('bogus://url');
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteNonExistingResource()
+    {
+        $handler = new StreamHandler('/foo/bar/baz/'.rand(0, 10000));
+        $handler->handle($this->getRecord());
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php

@@ -0,0 +1,43 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+use Monolog\Logger;
+
+class SyslogHandlerTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Handler\SyslogHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new SyslogHandler('test');
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', LOG_USER);
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', 'user');
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR);
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+    }
+
+    /**
+     * @covers Monolog\Handler\SyslogHandler::__construct
+     */
+    public function testConstructInvalidFacility()
+    {
+        $this->setExpectedException('UnexpectedValueException');
+        $handler = new SyslogHandler('test', 'unknown');
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php

@@ -0,0 +1,56 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\TestHandler
+ */
+class TestHandlerTest extends TestCase
+{
+    /**
+     * @dataProvider methodProvider
+     */
+    public function testHandler($method, $level)
+    {
+        $handler = new TestHandler;
+        $record = $this->getRecord($level, 'test'.$method);
+        $this->assertFalse($handler->{'has'.$method}($record));
+        $this->assertFalse($handler->{'has'.$method.'Records'}());
+        $handler->handle($record);
+
+        $this->assertFalse($handler->{'has'.$method}('bar'));
+        $this->assertTrue($handler->{'has'.$method}($record));
+        $this->assertTrue($handler->{'has'.$method}('test'.$method));
+        $this->assertTrue($handler->{'has'.$method.'Records'}());
+
+        $records = $handler->getRecords();
+        unset($records[0]['formatted']);
+        $this->assertEquals(array($record), $records);
+    }
+
+    public function methodProvider()
+    {
+        return array(
+            array('Emergency', Logger::EMERGENCY),
+            array('Alert'    , Logger::ALERT),
+            array('Critical' , Logger::CRITICAL),
+            array('Error'    , Logger::ERROR),
+            array('Warning'  , Logger::WARNING),
+            array('Info'     , Logger::INFO),
+            array('Notice'   , Logger::NOTICE),
+            array('Debug'    , Logger::DEBUG),
+        );
+    }
+}

vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php

@@ -0,0 +1,69 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class ZendMonitorHandlerTest extends TestCase
+{
+    protected $zendMonitorHandler;
+
+    public function setUp()
+    {
+        if (!function_exists('zend_monitor_custom_event')) {
+            $this->markTestSkipped('ZendServer is not installed');
+        }
+    }
+
+    /**
+     * @covers  Monolog\Handler\ZendMonitorHandler::write
+     */
+    public function testWrite()
+    {
+        $record = $this->getRecord();
+        $formatterResult = array(
+            'message' => $record['message']
+        );
+
+        $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler')
+            ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter'))
+            ->getMock();
+
+        $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter')
+            ->disableOriginalConstructor()
+            ->getMock();
+
+        $formatterMock->expects($this->once())
+            ->method('format')
+            ->will($this->returnValue($formatterResult));
+
+        $zendMonitor->expects($this->once())
+            ->method('getDefaultFormatter')
+            ->will($this->returnValue($formatterMock));
+
+        $levelMap = $zendMonitor->getLevelMap();
+
+        $zendMonitor->expects($this->once())
+            ->method('writeZendMonitorCustomEvent')
+            ->with($levelMap[$record['level']], $record['message'], $formatterResult);
+
+        $zendMonitor->handle($record);
+    }
+
+    /**
+     * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter
+     */
+    public function testGetDefaultFormatterReturnsNormalizerFormatter()
+    {
+        $zendMonitor = new ZendMonitorHandler();
+        $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter());
+    }
+}